4-(4-(4-methyl-3-(4-methylpiperazin-1-ylsulfonyl)phenyl)phthalazin-1-ylamino)benzenesulfonamide

ID: ALA5196274

PubChem CID: 4267335

Max Phase: Preclinical

Molecular Formula: C26H28N6O4S2

Molecular Weight: 552.68

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2nnc(Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)cc1S(=O)(=O)N1CCN(C)CC1

Standard InChI:  InChI=1S/C26H28N6O4S2/c1-18-7-8-19(17-24(18)38(35,36)32-15-13-31(2)14-16-32)25-22-5-3-4-6-23(22)26(30-29-25)28-20-9-11-21(12-10-20)37(27,33)34/h3-12,17H,13-16H2,1-2H3,(H,28,30)(H2,27,33,34)

Standard InChI Key:  YLOUQDZQNSMSCP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -0.0583    4.0123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3535    3.2975    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7662    4.0123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0670    2.8856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3599    2.8856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3599    2.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0717    1.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7843    2.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7843    2.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0706    3.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0706    4.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0717    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7832    0.4145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7832   -0.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0666   -0.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0666   -1.6466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3531   -2.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3531   -2.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3622   -3.2934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714   -2.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7848   -3.2941    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1975   -2.5811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6102   -3.2941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7848   -4.1179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714   -2.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3604   -1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3561   -0.4068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3561    0.4128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4921   -0.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2073   -0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2073    0.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4939    0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7804    3.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4938    2.8856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4938    2.0617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7804    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0670    2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2073    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  2  0
  2  4  1  0
  5  2  1  0
  6  5  2  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  5 10  1  0
 10 11  1  0
 12  7  1  0
 13 12  1  0
 14 13  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  2  0
 21 24  1  0
 20 25  2  0
 25 26  1  0
 26 17  2  0
 15 27  2  0
 27 28  1  0
 28 12  2  0
 29 14  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 13 32  1  0
 33  4  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 37 36  1  0
  4 37  1  0
 35 38  1  0
M  END

Associated Targets(Human)

ENPP3 Tchem Ectonucleotide pyrophosphatase/phosphodiesterase family member 3 (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 552.68Molecular Weight (Monoisotopic): 552.1613AlogP: 2.93#Rotatable Bonds: 6
Polar Surface Area: 138.59Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.74CX Basic pKa: 6.00CX LogP: 2.85CX LogD: 2.84
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -1.78

References

1. Lee SY, Namasivayam V, Boshta NM, Perotti A, Mirza S, Bua S, Supuran CT, Müller CE..  (2021)  Discovery of potent nucleotide pyrophosphatase/phosphodiesterase3 (NPP3) inhibitors with ancillary carbonic anhydrase inhibition for cancer (immuno)therapy.,  12  (7.0): [PMID:34355184] [10.1039/D1MD00117E]
2. Ahmad, Haseen and 7 more authors.  2020-12-15  Synthesis of biphenyl oxazole derivatives via Suzuki coupling and biological evaluations as nucleotide pyrophosphatase/phosphodiesterase-1 and -3 inhibitors.  [PMID:32883636]

Source