2-(1-Ethyl-3-methyl-1H-pyrazole-5-carboxamido)-1-(4-pivalamidobutyl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA5196300

PubChem CID: 164903405

Max Phase: Preclinical

Molecular Formula: C24H33N7O3

Molecular Weight: 467.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)ccc2n1CCCCNC(=O)C(C)(C)C

Standard InChI:  InChI=1S/C24H33N7O3/c1-6-31-19(13-15(2)29-31)21(33)28-23-27-17-14-16(20(25)32)9-10-18(17)30(23)12-8-7-11-26-22(34)24(3,4)5/h9-10,13-14H,6-8,11-12H2,1-5H3,(H2,25,32)(H,26,34)(H,27,28,33)

Standard InChI Key:  HDWRZKKJEVUVMY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   -2.6487   -0.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6499   -1.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9371   -1.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2254   -1.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2256   -0.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9389   -0.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4419   -0.2354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0426   -0.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4415   -1.5687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8652   -0.9015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2762   -0.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0988   -0.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5798   -0.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3620   -0.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3618    0.2233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5793    0.4771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3663    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0746   -1.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8647    0.5231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1880    0.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7388    1.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4848    1.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3626   -1.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3632   -2.5520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0746   -1.3176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9481    1.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0356    2.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8403    2.3807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0943    1.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8990    1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5125    1.0164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1530    0.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4809    2.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6939    1.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  4  1  0
  5  6  2  0
  6  1  1  0
  7  5  1  0
  8  7  1  0
  9  8  2  0
  4  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 16 17  1  0
 14 18  1  0
 11 19  2  0
  7 20  1  0
 20 21  1  0
 21 22  1  0
  2 23  1  0
 23 24  2  0
 23 25  1  0
 17 26  1  0
 22 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 30 33  1  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5196300

    ---

Associated Targets(Human)

STING1 Tchem Stimulator of interferon genes protein (1885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
THP1-Dual (100 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.57Molecular Weight (Monoisotopic): 467.2645AlogP: 2.85#Rotatable Bonds: 9
Polar Surface Area: 136.93Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.47CX Basic pKa: 1.96CX LogP: 2.34CX LogD: 2.34
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -2.03

References

1. Jeon MJ, Lee H, Lee J, Baek SY, Lee D, Jo S, Lee JY, Kang M, Jung HR, Han SB, Kim NJ, Lee S, Kim H..  (2022)  Development of Potent Immune Modulators Targeting Stimulator of Interferon Genes Receptor.,  65  (7.0): [PMID:35315650] [10.1021/acs.jmedchem.1c01795]

Source