The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3aR,4R,7S,7aR)-3-(5-(furan-3-yl)pyridin-3-yl)-N-(1H-indazol-5-yl)-4,5,6,7-tetrahydro-4,7-methanobenzo[d]isoxazole-7a(3aH)-carboxamide ID: ALA5196347
PubChem CID: 168285128
Max Phase: Preclinical
Molecular Formula: C25H21N5O3
Molecular Weight: 439.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc2[nH]ncc2c1)[C@]12ON=C(c3cncc(-c4ccoc4)c3)[C@H]1[C@@H]1CC[C@H]2C1
Standard InChI: InChI=1S/C25H21N5O3/c31-24(28-20-3-4-21-17(9-20)12-27-29-21)25-19-2-1-14(8-19)22(25)23(30-33-25)18-7-16(10-26-11-18)15-5-6-32-13-15/h3-7,9-14,19,22H,1-2,8H2,(H,27,29)(H,28,31)/t14-,19+,22-,25-/m1/s1
Standard InChI Key: LITMCUYQKURFCJ-GXCVBTPRSA-N
Molfile:
RDKit 2D
36 42 0 0 0 0 0 0 0 0999 V2000
2.6261 2.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8712 1.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4676 1.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8716 0.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4674 -0.3034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6594 -0.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2515 -1.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0545 -1.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8380 -1.9455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0955 -2.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6161 -3.0426 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.8988 -2.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3782 -1.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7719 -1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2322 -2.2529 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.0091 -1.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6872 -1.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3809 -1.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0773 -1.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0773 -2.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3792 -3.0195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6872 -2.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7772 -1.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9519 -0.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7590 -0.5356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0829 -1.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4770 -1.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0091 -0.6079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7927 -0.3641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7119 -0.9847 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.2592 0.3985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6831 0.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0829 1.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6795 1.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9204 2.5607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2663 3.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
5 4 1 0
6 5 1 0
7 6 1 1
7 8 1 0
8 9 1 0
10 9 1 0
10 11 1 6
10 12 1 0
12 13 1 0
13 8 1 0
14 10 1 0
14 7 1 0
14 15 1 1
16 14 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 2 0
23 19 1 0
23 24 2 0
24 25 1 0
26 25 1 0
27 26 2 0
23 27 1 0
16 28 2 0
28 29 1 0
29 7 1 0
8 30 1 6
6 31 2 0
4 32 1 0
32 33 2 0
33 34 1 0
34 2 2 0
34 35 1 0
35 36 1 0
1 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.48Molecular Weight (Monoisotopic): 439.1644AlogP: 4.38#Rotatable Bonds: 4Polar Surface Area: 105.40Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.99CX Basic pKa: 3.69CX LogP: 3.10CX LogD: 3.10Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -0.39
References 1. Yin L, Pan Y, Xue Y, Chen X, You T, Huang J, Xu Q, Hu Q.. (2022) Design, Synthesis, and Biological Evaluations of Pyridyl 4,5,6,7-Tetrahydro-4,7-Methanobenzo[d ]isoxazoles as Potent and Selective Inhibitors of 11β-Hydroxylase., 65 (17.0): [PMID:35975976 ] [10.1021/acs.jmedchem.2c01037 ]