ID: ALA5196562

PubChem CID: 168286775

Max Phase: Preclinical

Molecular Formula: C23H30N2O5

Molecular Weight: 414.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=N/N2C(=O)[C@H](C)[C@@H]3CC[C@@H](C)[C@@H]4CC[C@@]5(C)OO[C@]43[C@H]2O5)cc1

Standard InChI:  InChI=1S/C23H30N2O5/c1-14-5-10-19-15(2)20(26)25(24-13-16-6-8-17(27-4)9-7-16)21-23(19)18(14)11-12-22(3,28-21)29-30-23/h6-9,13-15,18-19,21H,5,10-12H2,1-4H3/b24-13+/t14-,15-,18+,19+,21-,22-,23-/m1/s1

Standard InChI Key:  JKQOBGQTGACJET-RZIPMTKBSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    0.7230   -0.4765    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4374   -0.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1427    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4411    0.6106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0286    1.3250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3142    0.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5107    0.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6378    0.1502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7093    1.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5199    1.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1427    1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1427    2.0613    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8569    1.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8569    2.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5712    1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5712    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8569   -0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5714   -0.4133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8569   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5714   -1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426   -1.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426   -2.0629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4374   -0.8255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7139   -1.2380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -2.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4278   -2.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1425   -2.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1425   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4324   -0.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8569   -2.4735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5714   -2.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  6
  5  4  1  0
  6  5  1  6
  6  7  1  0
  6  8  1  0
  8  2  1  0
  9  6  1  0
  9 10  1  0
 10 11  1  0
 11  3  1  0
 11 12  1  6
 11 13  1  0
 13 14  1  6
 15 13  1  0
 16 15  1  0
 17 16  1  0
 17  3  1  0
 17 18  1  6
 17 19  1  0
 19 20  1  1
 21 19  1  0
 21 22  2  0
 23 21  1  0
  2 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 29 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5196562

    ---

Associated Targets(non-human)

Plasmodium yoelii nigeriensis (1119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.50Molecular Weight (Monoisotopic): 414.2155AlogP: 3.72#Rotatable Bonds: 3
Polar Surface Area: 69.59Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.46CX LogP: 4.37CX LogD: 4.37
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: 1.45

References

1. Karnatak M, Hassam M, Singh AS, Yadav DK, Singh C, Puri SK, Verma VP..  (2022)  Novel hydrazone derivatives of N-amino-11-azaartemisinin with high order of antimalarial activity against multidrug-resistant Plasmodium yoelii nigeriensis in Swiss mice via intramuscular route.,  58  [PMID:34974111] [10.1016/j.bmcl.2021.128522]

Source