5-chloro-2-(3-methylphenyl)quinazolin-4(3H)-one

ID: ALA5196748

PubChem CID: 164880774

Max Phase: Preclinical

Molecular Formula: C15H11ClN2O

Molecular Weight: 270.72

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(-c2nc3cccc(Cl)c3c(=O)[nH]2)c1

Standard InChI:  InChI=1S/C15H11ClN2O/c1-9-4-2-5-10(8-9)14-17-12-7-3-6-11(16)13(12)15(19)18-14/h2-8H,1H3,(H,17,18,19)

Standard InChI Key:  QXLAOCDPGHPKEH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 21  0  0  0  0  0  0  0  0999 V2000
   -2.8577   -0.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4304   -0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153   -0.6196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002    0.6188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4304    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1427    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8577    0.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153    1.8573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7148   -0.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7148   -1.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318   -1.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426   -1.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426   -0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4300   -0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1427    1.8566    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.8577   -0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  8  7  1  0
  3  8  2  0
  8  9  1  0
  9 10  2  0
 10  1  1  0
  7 11  2  0
  5 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
  9 18  1  0
 16 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5196748

    ---

Associated Targets(Human)

PBRM1 Tchem Protein polybromo-1 (712 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 270.72Molecular Weight (Monoisotopic): 270.0560AlogP: 3.55#Rotatable Bonds: 1
Polar Surface Area: 45.75Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.71CX Basic pKa: 3.84CX LogP: 3.75CX LogD: 3.60
Aromatic Rings: 3Heavy Atoms: 19QED Weighted: 0.73Np Likeness Score: -1.40

References

1. Shishodia S, Nuñez R, Strohmier BP, Bursch KL, Goetz CJ, Olp MD, Jensen DR, Fenske TG, Ordonez-Rubiano SC, Blau ME, Roach MK, Peterson FC, Volkman BF, Dykhuizen EC, Smith BC..  (2022)  Selective and Cell-Active PBRM1 Bromodomain Inhibitors Discovered through NMR Fragment Screening.,  65  (20.0): [PMID:36227159] [10.1021/acs.jmedchem.2c00864]

Source