The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(trans)-(S)-4-(2-cyanopyridin-4-yloxy)-N-(4-((3-ethylpiperazin-1-yl)methyl)-3-methylphenyl)-N-methylcyclohexanecarboxamide ID: ALA5196819
PubChem CID: 168288449
Max Phase: Preclinical
Molecular Formula: C28H37N5O2
Molecular Weight: 475.64
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H]1CN(Cc2ccc(N(C)C(=O)[C@H]3CC[C@H](Oc4ccnc(C#N)c4)CC3)cc2C)CCN1
Standard InChI: InChI=1S/C28H37N5O2/c1-4-23-19-33(14-13-31-23)18-22-5-8-25(15-20(22)2)32(3)28(34)21-6-9-26(10-7-21)35-27-11-12-30-24(16-27)17-29/h5,8,11-12,15-16,21,23,26,31H,4,6-7,9-10,13-14,18-19H2,1-3H3/t21-,23-,26-/m0/s1
Standard InChI Key: HIBINNMRINZALX-KJOQGJGQSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-3.9272 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2127 1.8569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4983 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4983 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2127 0.2069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9272 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2127 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4985 -1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7841 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0724 -1.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0724 -1.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7824 -2.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4985 -1.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7841 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -2.2669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 -1.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -3.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 -1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 -2.2669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 1.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 1.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0703 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7827 3.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4972 2.6791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4987 1.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7873 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7841 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2127 -2.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2130 1.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9272 1.0339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
3 14 1 1
11 15 1 0
15 16 1 0
15 17 1 0
18 16 1 1
16 19 2 0
20 18 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
18 24 1 0
22 25 1 6
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
14 32 1 0
13 33 1 0
34 30 1 0
34 35 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.64Molecular Weight (Monoisotopic): 475.2947AlogP: 4.05#Rotatable Bonds: 7Polar Surface Area: 81.49Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.48CX LogP: 4.02CX LogD: 1.96Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.65Np Likeness Score: -1.05
References 1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M.. (2022) Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure., 59 [PMID:35051575 ] [10.1016/j.bmcl.2022.128554 ]