The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(((6-chloro-8-nitro-4-oxo-4H-benzo[e][1,3]thiazin-2-yl)thio)methyl)-1H-1,2,3-triazol-1-yl)-N-(4-chlorophenyl)acetamide ID: ALA5196862
PubChem CID: 168285196
Max Phase: Preclinical
Molecular Formula: C19H12Cl2N6O4S2
Molecular Weight: 523.38
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cn1cc(CSc2nc(=O)c3cc(Cl)cc([N+](=O)[O-])c3s2)nn1)Nc1ccc(Cl)cc1
Standard InChI: InChI=1S/C19H12Cl2N6O4S2/c20-10-1-3-12(4-2-10)22-16(28)8-26-7-13(24-25-26)9-32-19-23-18(29)14-5-11(21)6-15(27(30)31)17(14)33-19/h1-7H,8-9H2,(H,22,28)
Standard InChI Key: JNVMQRCLEYHDKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
1.7767 -1.4904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5971 -1.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9327 -0.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7532 -0.5643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0888 0.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9093 0.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2449 1.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7599 1.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0956 2.4504 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.9394 1.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6039 0.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2246 -0.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4709 -1.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2435 -0.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9580 -1.2129 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.6725 -0.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6725 0.0246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3870 0.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3870 1.2621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1015 0.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1015 -0.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8159 -1.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5305 -0.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5305 0.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8159 0.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2449 0.4371 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8159 -2.0379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5305 -2.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1015 -2.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3870 -1.2129 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.5571 -2.0334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3641 -2.2049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5200 0.0641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
8 10 2 0
11 5 2 0
10 11 1 0
12 1 1 0
12 13 2 0
14 13 1 0
15 14 1 0
16 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
20 18 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
20 25 1 0
25 24 2 0
24 26 1 0
22 27 1 0
27 28 1 0
27 29 2 0
21 30 1 0
30 16 1 0
31 13 1 0
32 31 2 0
1 32 1 0
3 33 2 0
M CHG 2 27 1 28 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.38Molecular Weight (Monoisotopic): 521.9739AlogP: 4.39#Rotatable Bonds: 7Polar Surface Area: 132.91Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.23CX Basic pKa: 0.20CX LogP: 4.46CX LogD: 4.46Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -2.42
References 1. Sahoo SK, Ahmad MN, Kaul G, Nanduri S, Dasgupta A, Chopra S, Yaddanapudi VM.. (2022) Synthesis and evaluation of triazole congeners of nitro-benzothiazinones potentially active against drug resistant Mycobacterium tuberculosis demonstrating bactericidal efficacy., 13 (5.0): [PMID:35694687 ] [10.1039/d1md00387a ]