The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-(Pyridin-2-yl)piperazin-1-yl)propyl)-3,4-dihydroquinolin-2(1H)-one oxalate ID: ALA5196873
PubChem CID: 168285559
Max Phase: Preclinical
Molecular Formula: C23H28N4O5
Molecular Weight: 350.47
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(=O)O.O=C1CCc2ccccc2N1CCCN1CCN(c2ccccn2)CC1
Standard InChI: InChI=1S/C21H26N4O.C2H2O4/c26-21-10-9-18-6-1-2-7-19(18)25(21)13-5-12-23-14-16-24(17-15-23)20-8-3-4-11-22-20;3-1(4)2(5)6/h1-4,6-8,11H,5,9-10,12-17H2;(H,3,4)(H,5,6)
Standard InChI Key: XBLQWGDDRIRBTR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
0.7153 -0.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4298 0.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1443 -0.0457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1443 -0.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4298 -1.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7153 -0.8708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 -1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 -0.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 -1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1418 -0.8708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8560 -1.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5703 -0.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5703 -0.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8560 0.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1418 -0.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 0.3663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2874 -1.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2825 -2.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5709 -2.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -2.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8586 0.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 1.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5713 1.6019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2858 1.1894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2874 0.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5760 -0.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1436 1.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5708 1.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5708 2.5181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2856 1.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1436 0.4549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8583 1.6929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 1 0
15 14 1 0
10 15 1 0
15 16 2 0
12 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
11 20 1 0
3 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
27 28 1 0
28 29 2 0
28 30 1 0
27 31 2 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 350.47Molecular Weight (Monoisotopic): 350.2107AlogP: 2.57#Rotatable Bonds: 5Polar Surface Area: 39.68Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.49CX LogP: 2.57CX LogD: 2.22Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.83Np Likeness Score: -1.80
References 1. Pavletić P, Semeano A, Yano H, Bonifazi A, Giorgioni G, Piergentili A, Quaglia W, Sabbieti MG, Agas D, Santoni G, Pallini R, Ricci-Vitiani L, Sabato E, Vistoli G, Del Bello F.. (2022) Highly Potent and Selective Dopamine D4 Receptor Antagonists Potentially Useful for the Treatment of Glioblastoma., 65 (18.0): [PMID:36098685 ] [10.1021/acs.jmedchem.2c00840 ]