The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((S)-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-1-hydroxyethyl)-trans-1,3-dioxan-5-yl)-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]thiazine-6-carboxamide ID: ALA5196889
PubChem CID: 168285571
Max Phase: Preclinical
Molecular Formula: C23H22FN5O6S
Molecular Weight: 515.52
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2ncc(F)c(C[C@H](O)[C@H]3OC[C@H](NC(=O)c4ccc5c(n4)NC(=O)CS5)CO3)c2n1
Standard InChI: InChI=1S/C23H22FN5O6S/c1-33-19-5-3-14-20(29-19)12(13(24)7-25-14)6-16(30)23-34-8-11(9-35-23)26-22(32)15-2-4-17-21(27-15)28-18(31)10-36-17/h2-5,7,11,16,23,30H,6,8-10H2,1H3,(H,26,32)(H,27,28,31)/t11-,16-,23-/m0/s1
Standard InChI Key: HVMVZISHQKEBLK-QNEUBCLTSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-4.3365 -1.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3406 -2.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6269 -2.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9175 -2.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9175 -1.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6269 -1.2774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2121 -1.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5025 -1.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4984 -2.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2079 -2.9151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7971 -1.2650 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.2161 -0.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6057 0.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7789 0.8964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7930 0.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3846 -0.6091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4238 -0.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8363 0.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4321 0.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3887 0.8057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6573 0.0880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0697 0.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8906 0.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2949 0.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1116 0.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5242 0.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1116 1.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2949 1.5028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5242 2.2124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3492 2.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7576 1.4946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3409 0.7850 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0033 -0.6957 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.0501 -1.2815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7596 -1.6899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6592 1.5084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7596 2.9191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 4 1 0
5 6 2 0
6 1 1 0
7 5 1 0
8 7 2 0
9 8 1 0
10 9 2 0
4 10 1 0
8 11 1 0
7 12 1 0
12 13 1 0
13 14 1 6
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
18 21 1 6
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
27 26 1 0
27 28 2 0
28 23 1 0
27 29 1 0
30 29 1 0
31 30 1 0
32 31 1 0
26 32 1 0
15 33 1 6
1 34 1 0
34 35 1 0
22 36 2 0
30 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.52Molecular Weight (Monoisotopic): 515.1275AlogP: 1.29#Rotatable Bonds: 6Polar Surface Area: 144.79Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.49CX Basic pKa: 1.90CX LogP: 1.47CX LogD: 1.47Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -0.76
References 1. Lu Y, Mann CA, Nolan S, Collins JA, Parker E, Papa J, Vibhute S, Jahanbakhsh S, Thwaites M, Hufnagel D, Hazbón MH, Moreno J, Stedman TT, Wittum T, Wozniak DJ, Osheroff N, Yalowich JC, Mitton-Fry MJ.. (2022) 1,3-Dioxane-Linked Novel Bacterial Topoisomerase Inhibitors: Expanding Structural Diversity and the Antibacterial Spectrum., 13 (6.0): [PMID:35707162 ] [10.1021/acsmedchemlett.2c00111 ]