3-((3aS,4R,9bR)-5-acetyl-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzoic acid

ID: ALA5197004

PubChem CID: 168285582

Max Phase: Preclinical

Molecular Formula: C23H23NO4

Molecular Weight: 377.44

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1cccc2c1N(C(C)=O)[C@@H](c1cccc(C(=O)O)c1)[C@H]1CC=C[C@@H]21

Standard InChI:  InChI=1S/C23H23NO4/c1-3-28-20-12-6-11-19-17-9-5-10-18(17)21(24(14(2)25)22(19)20)15-7-4-8-16(13-15)23(26)27/h4-9,11-13,17-18,21H,3,10H2,1-2H3,(H,26,27)/t17-,18+,21+/m1/s1

Standard InChI Key:  KZHKKFPHDWPLFI-LQWHRVPQSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -3.2133    0.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4987    1.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867    0.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867    0.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4969   -0.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2133    0.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4969   -1.0651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0721   -0.2407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575    0.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575    0.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0721    1.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9005    2.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0799    2.3029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2557    1.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6556    1.9931    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4676    0.9970    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571   -0.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719    0.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7839   -0.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7839   -1.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0737   -1.4777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571   -1.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2115   -1.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2115   -2.3029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0721   -1.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575   -1.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867   -1.4785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986    0.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2133   -0.2403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986    0.9974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  3 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 10 14  1  0
 11 15  1  1
 10 16  1  1
  9 17  1  6
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
  7 23  1  0
 23 24  1  0
  8 25  1  0
 25 26  1  0
 25 27  2  0
 28 19  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5197004

    ---

Associated Targets(Human)

JAR (316 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.44Molecular Weight (Monoisotopic): 377.1627AlogP: 4.55#Rotatable Bonds: 4
Polar Surface Area: 66.84Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.03CX Basic pKa: CX LogP: 3.47CX LogD: 0.33
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.79Np Likeness Score: -0.11

References

1. Goebel GL, Hohnen L, Borgelt L, Hommen P, Qiu X, Lightfoot H, Wu P..  (2022)  Small molecules with tetrahydroquinoline-containing Povarov scaffolds as inhibitors disrupting the Protein-RNA interaction of LIN28-let-7.,  228  [PMID:34883291] [10.1016/j.ejmech.2021.114014]

Source