(R)-5-(2-(1H-indol-4-yl)-4-(3-methylmorpholino)quinazolin-6-yl)picolinonitrile

ID: ALA5197038

PubChem CID: 168286376

Max Phase: Preclinical

Molecular Formula: C27H22N6O

Molecular Weight: 446.51

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1COCCN1c1nc(-c2cccc3[nH]ccc23)nc2ccc(-c3ccc(C#N)nc3)cc12

Standard InChI:  InChI=1S/C27H22N6O/c1-17-16-34-12-11-33(17)27-23-13-18(19-5-7-20(14-28)30-15-19)6-8-25(23)31-26(32-27)22-3-2-4-24-21(22)9-10-29-24/h2-10,13,15,17,29H,11-12,16H2,1H3

Standard InChI Key:  NUTKSDJGTYDWBI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    3.2437    1.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9579    1.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9579    2.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2457    2.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5354    2.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5354    1.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8261    1.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1114    1.4425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4035    1.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4035    0.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1135   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8261    0.2054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1135   -1.0245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4028   -1.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4028   -2.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1134   -2.6715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8242   -2.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8242   -1.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3061   -1.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3086   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0196    0.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0196    1.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3086    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7286   -0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4393    0.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1500   -0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1500   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4393   -1.4466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7286   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8607   -1.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5715   -1.8458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5715    0.8888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2366    0.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4160    0.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 10 11  1  0
  7 12  1  0
 12 11  2  0
 13 11  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 16 17  1  0
 13 18  1  0
 18 17  1  0
 19 14  1  0
 10 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
  9 23  1  0
 21 24  1  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 24 29  2  0
 28 29  1  0
 27 30  1  0
 30 31  3  0
  2 32  1  0
 32 33  1  0
 33 34  2  0
  1 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5197038

    ---

Associated Targets(Human)

ATR Tchem Serine-protein kinase ATR (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.51Molecular Weight (Monoisotopic): 446.1855AlogP: 4.94#Rotatable Bonds: 3
Polar Surface Area: 90.72Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.57CX LogP: 5.52CX LogD: 5.52
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.03

References

1. Bin H, Chen P, Wu M, Wang F, Lin G, Pan S, Liu J, Mu B, Nan J, Huang Q, Li L, Yang S..  (2022)  Discovery of a potent and highly selective inhibitor of ataxia telangiectasia mutated and Rad3-Related (ATR) kinase: Structural activity relationship and antitumor activity both in vitro and in vivo.,  232  [PMID:35183872] [10.1016/j.ejmech.2022.114187]

Source