The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3,5-bis(trifluoromethyl)phenyl)-10,11-methylenedioxy-20(S)-camptothecin ID: ALA5197149
PubChem CID: 146275671
Max Phase: Preclinical
Molecular Formula: C29H18F6N2O6
Molecular Weight: 604.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)OCO3
Standard InChI: InChI=1S/C29H18F6N2O6/c1-2-27(40)18-7-20-24-16(9-37(20)25(38)17(18)10-41-26(27)39)23(15-6-21-22(43-11-42-21)8-19(15)36-24)12-3-13(28(30,31)32)5-14(4-12)29(33,34)35/h3-8,40H,2,9-11H2,1H3/t27-/m0/s1
Standard InChI Key: OBOCUKLYOYBDTR-MHZLTWQESA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
-2.5708 -0.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8562 0.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1443 -0.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1443 -0.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8544 -1.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5708 -0.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3587 -1.2111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8456 -0.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3586 0.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4265 -1.3656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2849 -0.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2832 -0.1279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4316 0.2844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4316 1.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0634 0.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5475 -0.5356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0663 -1.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4035 -1.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2202 -2.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6972 -1.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3615 -0.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7721 0.0910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5101 -1.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8456 -2.1960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3683 -2.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5556 -2.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7611 -2.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1803 -2.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3422 -3.5700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7789 -3.5700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1427 1.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1419 2.3350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4306 2.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2776 2.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2824 1.5178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9887 2.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9887 3.5700 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6998 2.3384 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6998 3.1595 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.8529 2.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5640 2.3350 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.8529 3.5665 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5640 3.1560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
1 9 1 0
4 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
3 13 1 0
13 14 1 0
12 15 1 0
15 16 1 0
16 17 1 0
11 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 1 0
21 22 2 0
20 23 1 0
24 23 1 0
25 24 1 0
26 25 1 0
19 26 1 0
26 27 1 0
27 28 1 0
26 29 1 1
25 30 2 0
31 14 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
14 35 1 0
34 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
32 40 1 0
40 41 1 0
40 42 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 604.46Molecular Weight (Monoisotopic): 604.1069AlogP: 5.51#Rotatable Bonds: 2Polar Surface Area: 99.88Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.71CX Basic pKa: 3.53CX LogP: 4.25CX LogD: 4.25Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.21Np Likeness Score: 0.43
References 1. Zhang G, Yin R, Dai X, Wu G, Qi X, Yu R, Li J, Jiang T.. (2022) Design, synthesis, and biological evaluation of novel 7-substituted 10,11-methylenedioxy-camptothecin derivatives against drug-resistant small-cell lung cancer in vitro and in vivo., 241 [PMID:35932565 ] [10.1016/j.ejmech.2022.114610 ]