3-(3-(2-methoxyphenyl)-4-oxothiazolidin-2-yl)-N-(4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)butyl)benzamide

ID: ALA5197496

PubChem CID: 168284451

Max Phase: Preclinical

Molecular Formula: C25H25N3O5S

Molecular Weight: 479.56

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1N1C(=O)CSC1c1cccc(C(=O)NCCCCN2C(=O)C=CC2=O)c1

Standard InChI:  InChI=1S/C25H25N3O5S/c1-33-20-10-3-2-9-19(20)28-23(31)16-34-25(28)18-8-6-7-17(15-18)24(32)26-13-4-5-14-27-21(29)11-12-22(27)30/h2-3,6-12,15,25H,4-5,13-14,16H2,1H3,(H,26,32)

Standard InChI Key:  GQZXHRKBLUCVII-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -1.3607   -2.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5346   -1.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3243   -1.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9397   -1.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7671   -2.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9713   -2.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9199   -1.0448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1117   -1.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2297   -1.9739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3035   -0.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2525    0.1194    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0080   -0.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7265    0.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7265    1.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4487    1.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4487    2.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1707    2.6783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7372    2.6802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0187    2.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2995    2.6864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4189    2.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1339    2.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8566    2.2787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6111    2.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1707    2.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7620    1.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9498    1.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3634    0.8687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8258    3.4229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1658    1.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1658    0.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4461   -0.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5597   -2.6219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3450   -3.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  6  1  2  0
  5  6  1  0
  7  2  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
 13 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
 27 28  2  0
 24 29  2  0
 15 30  1  0
 30 31  2  0
 32 13  2  0
 31 32  1  0
  1 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5197496

    ---

Associated Targets(Human)

HOS-TE85 (154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.56Molecular Weight (Monoisotopic): 479.1515AlogP: 2.91#Rotatable Bonds: 9
Polar Surface Area: 96.02Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.09CX LogD: 2.09
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -0.90

References

1. Deng Y, Pi R, Niu L, Zhao Y, Ni D, Song L, Li Z, Han W, Wei Q, Han Y, Zhu T, Luo Z, Sun D, Dong S, Liu S..  (2022)  Novel 2-phenyl-3-(Pyridin-2-yl) thiazolidin-4-one derivatives as potent inhibitors for proliferation of osteosarcoma cells in vitro and in vivo.,  228  [PMID:34861640] [10.1016/j.ejmech.2021.114010]

Source