4-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)-N-(5-((4-ethylpiperazin-1-yl)methyl)pyridin-2-yl)-5-fluoropyrimidin-2-amine

ID: ALA5197501

PubChem CID: 168284457

Max Phase: Preclinical

Molecular Formula: C24H27FN6O2

Molecular Weight: 450.52

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN1CCN(Cc2ccc(Nc3ncc(F)c(-c4ccc5c(c4)OCCO5)n3)nc2)CC1

Standard InChI:  InChI=1S/C24H27FN6O2/c1-2-30-7-9-31(10-8-30)16-17-3-6-22(26-14-17)28-24-27-15-19(25)23(29-24)18-4-5-20-21(13-18)33-12-11-32-20/h3-6,13-15H,2,7-12,16H2,1H3,(H,26,27,28,29)

Standard InChI Key:  GLDVFVXCMSQZMZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -1.7843    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0697    1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579    1.0306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579    0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0679   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7843    0.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567   -0.2071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0713    0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0716    1.0306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845    1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4993    1.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5009    0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7889   -0.2089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2155   -0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9303    0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6424   -0.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6424   -1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9321   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2155   -1.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3573   -1.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0721   -1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0721   -0.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3573    0.2080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2139    1.4412    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4990    1.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2136    1.0301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2136    0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9282   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6428    0.2050    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6429    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9282    1.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3575   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0721    0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 12 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 16 23  1  0
 11 24  1  0
  1 25  1  0
 25 26  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 26 31  1  0
 29 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5197501

    ---

Associated Targets(Human)

CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK4 Tclin CDK4/Cyclin D3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.52Molecular Weight (Monoisotopic): 450.2180AlogP: 3.33#Rotatable Bonds: 6
Polar Surface Area: 75.64Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.28CX Basic pKa: 7.94CX LogP: 3.38CX LogD: 2.72
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -1.40

References

1. Chen W, Ji M, Cheng H, Zheng M, Xia F, Min W, Yang H, Wang X, Wang L, Cao L, Yuan K, Yang P..  (2022)  Discovery, Optimization, and Evaluation of Selective CDK4/6 Inhibitors for the Treatment of Breast Cancer.,  65  (22.0): [PMID:36350721] [10.1021/acs.jmedchem.2c00947]

Source