The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-hydroxyphenyl)(4-(4-(5-(trifluoromethyl)pyridin-2-yloxy)benzyl)piperidin-1-yl)methanone ID: ALA5197550
PubChem CID: 168284481
Max Phase: Preclinical
Molecular Formula: C25H23F3N2O3
Molecular Weight: 456.46
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cccc(O)c1)N1CCC(Cc2ccc(Oc3ccc(C(F)(F)F)cn3)cc2)CC1
Standard InChI: InChI=1S/C25H23F3N2O3/c26-25(27,28)20-6-9-23(29-16-20)33-22-7-4-17(5-8-22)14-18-10-12-30(13-11-18)24(32)19-2-1-3-21(31)15-19/h1-9,15-16,18,31H,10-14H2
Standard InChI Key: RUZNBYBKTJDHTH-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-1.4216 0.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4227 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7099 -0.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0043 -0.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0015 0.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7117 0.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1355 -0.8211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8478 -0.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8425 0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5538 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2676 0.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2656 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5537 -0.8207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9803 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9808 1.6479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.6926 0.4134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7124 0.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4205 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 -0.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1368 -0.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8465 -0.4123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8495 0.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1365 0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5581 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5563 -1.6479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2715 -0.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2745 0.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9782 -0.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6926 -0.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6918 0.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9805 0.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9778 1.6423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6478 1.3101 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
14 16 1 0
5 17 1 0
17 18 1 0
19 18 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 18 1 0
21 24 1 0
24 25 2 0
24 26 1 0
27 26 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 27 1 0
31 32 1 0
14 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.46Molecular Weight (Monoisotopic): 456.1661AlogP: 5.69#Rotatable Bonds: 5Polar Surface Area: 62.66Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.82CX Basic pKa: 0.80CX LogP: 5.44CX LogD: 5.42Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.23
References 1. Bononi G, Di Stefano M, Poli G, Ortore G, Meier P, Masetto F, Caligiuri I, Rizzolio F, Macchia M, Chicca A, Avan A, Giovannetti E, Vagaggini C, Brai A, Dreassi E, Valoti M, Minutolo F, Granchi C, Gertsch J, Tuccinardi T.. (2022) Reversible Monoacylglycerol Lipase Inhibitors: Discovery of a New Class of Benzylpiperidine Derivatives., 65 (10.0): [PMID:35522977 ] [10.1021/acs.jmedchem.1c01806 ]