panepophenanthrin

ID: ALA519800

PubChem CID: 44575998

Max Phase: Preclinical

Molecular Formula: C22H28O8

Molecular Weight: 420.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Panepophenanthrin | CHEMBL519800|BDBM50478558

Canonical SMILES:  CC(C)(O)/C=C/[C@@]12[C@H]3[C@@H](O)[C@@H]4O[C@@H]4[C@]1(O)OC(C)(C)[C@@H]2C=C1C(=O)[C@H]2O[C@H]2[C@H](O)[C@H]13

Standard InChI:  InChI=1S/C22H28O8/c1-19(2,26)5-6-21-9-7-8-10(13(24)16-15(28-16)12(8)23)11(21)14(25)17-18(29-17)22(21,27)30-20(9,3)4/h5-7,9-11,13-18,24-27H,1-4H3/b6-5+/t9-,10+,11+,13+,14+,15+,16-,17-,18-,21+,22-/m0/s1

Standard InChI Key:  WQBRQZUREPTGLI-MMNRQHNKSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   -0.7542   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -2.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6699   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6664   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3751   -3.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3821   -2.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -3.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7542   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4599   -3.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0358   -4.7310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1750   -3.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7478   -5.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4618   -4.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4581   -5.5573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6804   -5.1404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6667   -4.3250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0955   -2.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0940   -3.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8089   -3.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500   -1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -1.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8604   -1.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4667   -0.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -1.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0542   -3.0875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3701   -4.7424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8042   -2.2667    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -4.2208    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3417   -5.8542    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1792   -5.1417    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -0.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6042   -0.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0167   -0.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4250    0.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7326   -0.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2999    0.3479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8708   -2.2625    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 18 17  1  0
 19 18  1  0
 17 19  1  0
  7  8  1  0
  3  2  1  0
  3  4  1  0
  2 20  1  0
  1  8  2  0
  6 21  1  0
 20 21  1  0
  7 10  1  0
 20 22  1  0
  8  9  1  0
 20 23  1  0
  9 13  1  0
  6 24  1  6
 12 10  1  0
  4 25  1  6
  1  2  1  0
  5 26  1  6
  9 11  2  0
 17 27  1  6
 13 12  1  0
 18 28  1  6
 14 13  1  0
 12 29  1  1
 12 14  1  0
 13 30  1  1
  7  4  1  0
  3  6  1  0
 31 32  2  0
  4  5  1  0
 32 33  1  0
  5 18  1  0
 33 34  1  0
 10 15  1  1
 33 35  1  0
 17  6  1  0
 33 36  1  0
  3 31  1  6
  7 16  1  1
  2 37  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

UBA1 Tbio Ubiquitin-like modifier-activating enzyme 1 (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 420.46Molecular Weight (Monoisotopic): 420.1784AlogP: -0.56#Rotatable Bonds: 2
Polar Surface Area: 132.28Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.60CX Basic pKa: CX LogP: -0.56CX LogD: -0.56
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: 3.24

References

1. Sekizawa R, Ikeno S, Nakamura H, Naganawa H, Matsui S, Iinuma H, Takeuchi T..  (2002)  Panepophenanthrin, from a mushroom strain, a novel inhibitor of the ubiquitin-activating enzyme.,  65  (10): [PMID:12398550] [10.1021/np020098q]
2. da Silva SR, Paiva SL, Lukkarila JL, Gunning PT..  (2013)  Exploring a new frontier in cancer treatment: targeting the ubiquitin and ubiquitin-like activating enzymes.,  56  (6): [PMID:23360215] [10.1021/jm301420b]

Source