The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-chlorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-oxo-3,4-dihydrophthalazine-1-carboxamide ID: ALA5198002
PubChem CID: 168288629
Max Phase: Preclinical
Molecular Formula: C26H24ClN5O2
Molecular Weight: 473.96
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(NC(=O)c3nn(-c4ccc(Cl)cc4)c(=O)c4ccccc34)cc2)CC1
Standard InChI: InChI=1S/C26H24ClN5O2/c1-30-14-16-31(17-15-30)20-12-8-19(9-13-20)28-25(33)24-22-4-2-3-5-23(22)26(34)32(29-24)21-10-6-18(27)7-11-21/h2-13H,14-17H2,1H3,(H,28,33)
Standard InChI Key: NYXWKIBPHYYZHO-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-3.9276 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5012 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5012 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2112 -0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9276 -0.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7866 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 0.4124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 -0.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7866 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7866 -1.6503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0693 -0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0693 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3590 -2.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 -1.6538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7838 -2.0627 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.7866 1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5012 2.0627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 2.0627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0692 1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0692 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3590 0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 0.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7838 0.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4985 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2130 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2130 -0.4124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4985 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7838 -0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9276 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
10 11 2 0
9 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
7 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
25 28 1 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
28 33 1 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.96Molecular Weight (Monoisotopic): 473.1619AlogP: 4.04#Rotatable Bonds: 4Polar Surface Area: 70.47Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.68CX Basic pKa: 7.85CX LogP: 4.67CX LogD: 4.08Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.80
References 1. Shi W, Zhang P, Zou F, Zhou J, Yin Z, Cai Z, Ghaleb H, Jiang Y, Huang W, Liu Y, Qiu Q, Qian H.. (2022) Exploration of novel phthalazinone derivatives as potential efflux transporter inhibitors for reversing multidrug resistance and improving the oral absorption of paclitaxel., 233 [PMID:35247755 ] [10.1016/j.ejmech.2022.114231 ]