The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((2,6-dimethoxy-4-((2-methyl-[1,1'-biphenyl]-3-yl)methoxy)benzyl)amino)-N-hydroxyhexanamide ID: ALA5198026
PubChem CID: 142622676
Max Phase: Preclinical
Molecular Formula: C29H36N2O5
Molecular Weight: 492.62
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OCc2cccc(-c3ccccc3)c2C)cc(OC)c1CNCCCCCC(=O)NO
Standard InChI: InChI=1S/C29H36N2O5/c1-21-23(13-10-14-25(21)22-11-6-4-7-12-22)20-36-24-17-27(34-2)26(28(18-24)35-3)19-30-16-9-5-8-15-29(32)31-33/h4,6-7,10-14,17-18,30,33H,5,8-9,15-16,19-20H2,1-3H3,(H,31,32)
Standard InChI Key: MSEOSYUQEQHFPO-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
-4.2764 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2764 0.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5613 0.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8462 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1311 0.8254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4435 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7284 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0134 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7015 0.8254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7015 1.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0134 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7015 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4166 -0.3846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1317 -0.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8468 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5619 -0.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2770 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9921 -0.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7068 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4219 -0.7967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1367 -0.3837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7068 0.4412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7284 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7284 -1.6502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0135 -2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4435 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5613 1.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2764 2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9915 1.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9915 0.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7065 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4216 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1367 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1367 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4216 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7065 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 6 1 0
8 7 2 0
8 9 1 0
9 10 1 0
11 8 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 2 0
23 11 2 0
23 24 1 0
24 25 1 0
26 23 1 0
6 26 2 0
3 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 2 2 0
31 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.62Molecular Weight (Monoisotopic): 492.2624AlogP: 5.41#Rotatable Bonds: 14Polar Surface Area: 89.05Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.03CX Basic pKa: 8.29CX LogP: 4.59CX LogD: 3.97Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.16Np Likeness Score: -0.31
References 1. Xu X, Zhang D, Zhao T, Wang M, Li Y, Du Q, Kou J, Li Z, Bian J.. (2022) Novel biphenyl-based scaffold as potent and selective histone deacetylase 6 (HDAC6) inhibitors: Identification, development and pharmacological evaluation., 233 [PMID:35245830 ] [10.1016/j.ejmech.2022.114228 ]