(R)-3-methyl-4-(6-(1-methyl-1H-pyrazol-5-yl)-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-yl)morpholine

ID: ALA5198149

PubChem CID: 168289578

Max Phase: Preclinical

Molecular Formula: C24H23N7O

Molecular Weight: 425.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1COCCN1c1nc(-c2c[nH]c3ncccc23)nc2ccc(-c3ccnn3C)cc12

Standard InChI:  InChI=1S/C24H23N7O/c1-15-14-32-11-10-31(15)24-18-12-16(21-7-9-27-30(21)2)5-6-20(18)28-23(29-24)19-13-26-22-17(19)4-3-8-25-22/h3-9,12-13,15H,10-11,14H2,1-2H3,(H,25,26)/t15-/m1/s1

Standard InChI Key:  UNWCEVIHQWENQO-OAHLLOKOSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   -0.7151   -1.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -2.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -2.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7142   -3.2671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4300   -2.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4300   -2.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -1.6085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -0.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4319   -0.3700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4319    0.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7123    0.8757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0006    0.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0006   -0.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7177   -0.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4337   -0.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4337    0.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7177    0.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1476   -0.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9007   -0.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4529   -1.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0407   -1.7794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2301   -1.6067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6156   -2.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1462    0.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9008    0.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4529    1.1506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0398    1.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3048    2.6512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7494    3.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9373    3.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6807    2.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2323    1.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3  2  1  0
  4  3  1  0
  4  5  1  0
  6  5  1  0
  2  7  1  0
  7  6  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 13  8  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 12 17  1  0
 18 15  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 22 18  1  0
 23 22  1  0
 24 10  1  0
 24 25  2  0
 26 25  1  0
 26 27  1  0
 28 27  2  0
 28 29  1  0
 30 29  2  0
 31 30  1  0
 27 32  1  0
 32 31  2  0
 24 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5198149

    ---

Associated Targets(Human)

ATR Tchem Serine-protein kinase ATR (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.50Molecular Weight (Monoisotopic): 425.1964AlogP: 3.80#Rotatable Bonds: 3
Polar Surface Area: 84.75Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.98CX Basic pKa: 4.32CX LogP: 3.85CX LogD: 3.85
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.37

References

1. Bin H, Chen P, Wu M, Wang F, Lin G, Pan S, Liu J, Mu B, Nan J, Huang Q, Li L, Yang S..  (2022)  Discovery of a potent and highly selective inhibitor of ataxia telangiectasia mutated and Rad3-Related (ATR) kinase: Structural activity relationship and antitumor activity both in vitro and in vivo.,  232  [PMID:35183872] [10.1016/j.ejmech.2022.114187]

Source