The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-methylhexanoyl)-9H-pyrido[3,4-b]indole-3-carboxylic acid ID: ALA5198332
PubChem CID: 168287721
Max Phase: Preclinical
Molecular Formula: C19H20N2O3
Molecular Weight: 324.38
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCCC(=O)c1nc(C(=O)O)cc2c1[nH]c1ccccc12
Standard InChI: InChI=1S/C19H20N2O3/c1-11(2)6-5-9-16(22)18-17-13(10-15(21-18)19(23)24)12-7-3-4-8-14(12)20-17/h3-4,7-8,10-11,20H,5-6,9H2,1-2H3,(H,23,24)
Standard InChI Key: ZFHBLUOMPDQKTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 26 0 0 0 0 0 0 0 0999 V2000
-1.6124 -1.0109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2798 -0.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0249 0.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1999 0.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9450 -0.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6491 0.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1580 0.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4133 -0.0820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1346 -0.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0844 -0.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6368 -0.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3849 0.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5795 0.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0789 -1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7413 1.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5384 1.0679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5279 2.0785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8759 -1.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5044 -2.0785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4593 -1.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2563 -1.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8398 -0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6368 -0.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6262 0.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
4 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
5 9 1 0
2 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
3 13 1 0
9 14 1 0
15 7 1 0
15 16 1 0
15 17 2 0
14 18 1 0
14 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 324.38Molecular Weight (Monoisotopic): 324.1474AlogP: 4.42#Rotatable Bonds: 6Polar Surface Area: 83.05Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.30CX Basic pKa: 6.38CX LogP: 2.22CX LogD: 1.26Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.66Np Likeness Score: 0.43