The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5198344
PubChem CID: 168287725
Max Phase: Preclinical
Molecular Formula: C24H24N6O3
Molecular Weight: 444.50
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](NC(=O)c1ccc2cc1OCCOCCNc1ccn3ncc-2c3n1)c1ccncc1
Standard InChI: InChI=1S/C24H24N6O3/c1-16(17-4-7-25-8-5-17)28-24(31)19-3-2-18-14-21(19)33-13-12-32-11-9-26-22-6-10-30-23(29-22)20(18)15-27-30/h2-8,10,14-16H,9,11-13H2,1H3,(H,26,29)(H,28,31)/t16-/m1/s1
Standard InChI Key: FFVXISWLYSJERX-MRXNPFEDSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-2.1764 2.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4619 3.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7474 2.8064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7474 1.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4619 1.5689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1764 1.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0370 1.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0370 3.0613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5219 2.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8906 1.5690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8906 0.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6048 0.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6048 -0.4927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8906 -0.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1764 -0.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4621 -0.9051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0370 0.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7511 0.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7504 -0.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0360 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6754 -0.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6802 0.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0360 -1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7502 -1.9826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6782 -1.9826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4645 -1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1787 -1.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8931 -1.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6048 -1.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6048 -2.8072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8948 -3.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1787 -2.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4645 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 2 0
3 8 1 0
8 9 2 0
9 7 1 0
6 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
7 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
21 16 1 0
22 21 2 0
17 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
26 33 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.50Molecular Weight (Monoisotopic): 444.1910AlogP: 3.10#Rotatable Bonds: 3Polar Surface Area: 102.67Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.87CX Basic pKa: 5.01CX LogP: 1.99CX LogD: 1.99Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.21
References 1. Kurz CG, Preuss F, Tjaden A, Cusack M, Amrhein JA, Chatterjee D, Mathea S, Berger LM, Berger BT, Krämer A, Weller M, Weiss T, Müller S, Knapp S, Hanke T.. (2022) Illuminating the Dark: Highly Selective Inhibition of Serine/Threonine Kinase 17A with Pyrazolo[1,5-a ]pyrimidine-Based Macrocycles., 65 (11.0): [PMID:35608370 ] [10.1021/acs.jmedchem.2c00173 ]