The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Colletotricandin A ID: ALA5198630
PubChem CID: 168286007
Max Phase: Preclinical
Molecular Formula: C25H36O9
Molecular Weight: 480.55
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)/C=C/CC(C)/C=C/C(=O)O[C@@H]1[C@@H](O)[C@H](c2c(O)cc(O)cc2CO)O[C@H](CO)[C@H]1O
Standard InChI: InChI=1S/C25H36O9/c1-4-14(2)6-5-7-15(3)8-9-20(30)34-25-22(31)19(13-27)33-24(23(25)32)21-16(12-26)10-17(28)11-18(21)29/h5-6,8-11,14-15,19,22-29,31-32H,4,7,12-13H2,1-3H3/b6-5+,9-8+/t14?,15?,19-,22-,23+,24+,25+/m1/s1
Standard InChI Key: MEMRTQCBSGMTNP-QMSNVKALSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
-1.4286 2.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4286 2.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 2.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 2.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 3.2992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7148 3.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7148 4.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4272 4.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1417 4.1219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1417 3.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4318 2.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4318 2.0602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8559 4.5342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0005 4.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0005 5.3609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 1.6493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 0.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4286 -2.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4286 -2.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1427 -3.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1427 -4.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 -4.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 -5.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4286 -4.5362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 -2.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 0.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1427 1.6493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1427 3.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8570 2.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
5 7 1 1
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
12 13 1 0
10 14 1 0
8 15 1 0
15 16 1 0
4 17 1 6
3 18 1 1
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
22 30 1 0
19 31 2 0
2 32 1 6
1 33 1 1
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.55Molecular Weight (Monoisotopic): 480.2359AlogP: 1.84#Rotatable Bonds: 10Polar Surface Area: 156.91Molecular Species: NEUTRALHBA: 9HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.79CX Basic pKa: ┄CX LogP: 2.54CX LogD: 2.52Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: 2.57
References 1. Lee C, Gong J, Kim J, Ko H, An S, Bang S, Deyrup ST, Noh M, Shim SH.. (2022) Adiponectin-Secretion-Promoting Cyclic Peptide-Polyketide Hybrids from a Halophyte-Associated Fungus, Colletotrichum gloeosporioides JS0417., 85 (3.0): [PMID:35172097 ] [10.1021/acs.jnatprod.1c01102 ]