The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(4-bromophenyl)-5-(2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl)-5-(trifluoromethyl)phenol ID: ALA5198799
PubChem CID: 168286429
Max Phase: Preclinical
Molecular Formula: C21H13BrF3N3O2
Molecular Weight: 476.25
Associated Items:
Names and Identifiers Canonical SMILES: Oc1cc(C(F)(F)F)ccc1-c1nc(-c2ccccc2O)n(-c2ccc(Br)cc2)n1
Standard InChI: InChI=1S/C21H13BrF3N3O2/c22-13-6-8-14(9-7-13)28-20(16-3-1-2-4-17(16)29)26-19(27-28)15-10-5-12(11-18(15)30)21(23,24)25/h1-11,29-30H
Standard InChI Key: HMIUMTZYUDQYNP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
0.0844 -0.8269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5829 -0.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3280 0.4427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4970 0.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7519 -0.3420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9096 1.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4972 1.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9092 2.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7347 2.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1465 1.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7383 1.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3800 -0.5556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5938 -1.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3888 -1.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9724 -0.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7614 -0.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9661 0.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7525 0.8274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3280 1.8721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1472 3.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9724 3.2989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1472 4.1256 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4326 3.7115 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0844 -1.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7990 -2.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7983 -2.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0834 -3.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6284 -2.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6332 -2.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0834 -4.1256 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
6 4 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
6 11 1 0
11 10 2 0
12 2 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
12 17 1 0
17 16 2 0
17 18 1 0
7 19 1 0
9 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
24 1 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
24 29 1 0
29 28 2 0
27 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.25Molecular Weight (Monoisotopic): 475.0143AlogP: 5.79#Rotatable Bonds: 3Polar Surface Area: 71.17Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.61CX Basic pKa: ┄CX LogP: 6.82CX LogD: 6.61Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -1.10
References 1. Lao Y, Wang Y, Chen J, Huang P, Su R, Shi J, Jiang C, Zhang J.. (2022) Synthesis and biological evaluation of 1,2,4-triazole derivatives as potential Nrf2 activators for the treatment of cerebral ischemic injury., 236 [PMID:35390713 ] [10.1016/j.ejmech.2022.114315 ]