7-(furan-2-yl)-10,11-methylenedioxy-20(S)-camptothecin

ID: ALA5198898

PubChem CID: 146275738

Max Phase: Preclinical

Molecular Formula: C25H18N2O7

Molecular Weight: 458.43

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2-c1ccco1)OCO3

Standard InChI:  InChI=1S/C25H18N2O7/c1-2-25(30)15-7-17-22-13(9-27(17)23(28)14(15)10-32-24(25)29)21(18-4-3-5-31-18)12-6-19-20(34-11-33-19)8-16(12)26-22/h3-8,30H,2,9-11H2,1H3/t25-/m0/s1

Standard InChI Key:  PONCCDCDXUIPIS-VWLOTQADSA-N

Molfile:  

 
     RDKit          2D

 34 40  0  0  0  0  0  0  0  0999 V2000
   -2.5708    0.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8562    0.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1443    0.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1443   -0.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8544   -0.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5708   -0.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3587   -0.6104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8456    0.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3586    0.7300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4265   -0.7649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2849   -0.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2832    0.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4316    0.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4316    1.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0634    0.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5475    0.0649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0663   -0.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4035   -1.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2202   -1.4315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6972   -0.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3615   -0.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7721    0.6917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5101   -0.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8456   -1.5953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3683   -2.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5556   -2.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7611   -2.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1803   -1.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3422   -2.9692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7789   -2.9693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2322    2.1887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0213    2.9693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8420    2.9693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0955    2.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  1  9  1  0
  4 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
  3 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 11 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  1  0
 21 22  2  0
 20 23  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 19 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  1
 25 30  2  0
 31 14  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 14  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5198898

    ---

Associated Targets(Human)

2008 (263 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW-620 (52400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.43Molecular Weight (Monoisotopic): 458.1114AlogP: 3.07#Rotatable Bonds: 2
Polar Surface Area: 113.02Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.71CX Basic pKa: 2.37CX LogP: 1.55CX LogD: 1.55
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: 0.55

References

1. Zhang G, Yin R, Dai X, Wu G, Qi X, Yu R, Li J, Jiang T..  (2022)  Design, synthesis, and biological evaluation of novel 7-substituted 10,11-methylenedioxy-camptothecin derivatives against drug-resistant small-cell lung cancer in vitro and in vivo.,  241  [PMID:35932565] [10.1016/j.ejmech.2022.114610]

Source