The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[1-(benzenesulfonyl)indol-3-yl]-N-(4-imidazol-1-ylbutyl)butanamide ID: ALA5198912
PubChem CID: 168289570
Max Phase: Preclinical
Molecular Formula: C25H28N4O3S
Molecular Weight: 464.59
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCc1cn(S(=O)(=O)c2ccccc2)c2ccccc12)NCCCCn1ccnc1
Standard InChI: InChI=1S/C25H28N4O3S/c30-25(27-15-6-7-17-28-18-16-26-20-28)14-8-9-21-19-29(24-13-5-4-12-23(21)24)33(31,32)22-10-2-1-3-11-22/h1-5,10-13,16,18-20H,6-9,14-15,17H2,(H,27,30)
Standard InChI Key: QOBZZCBOKCBVSR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
1.2123 -0.9649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9268 -0.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6413 -0.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3559 -0.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0703 -0.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4978 -0.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2166 -0.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9311 -0.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6456 -0.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3976 0.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2047 0.4267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6173 -0.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0651 -0.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4219 -0.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6771 -1.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1291 -1.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3214 -1.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6173 1.1412 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.2047 1.8557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7922 1.1412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4423 1.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8550 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6776 1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0902 1.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6811 0.4284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8566 0.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3113 -0.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7851 -0.5523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8713 0.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6779 0.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0902 -0.2748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5384 -0.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4978 0.2726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 7 1 0
8 7 1 0
9 8 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
13 17 1 0
11 18 1 0
18 19 2 0
18 20 2 0
21 18 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
21 26 1 0
26 25 2 0
10 27 2 0
13 27 1 0
27 9 1 0
28 5 1 0
29 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 28 1 0
6 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.59Molecular Weight (Monoisotopic): 464.1882AlogP: 3.99#Rotatable Bonds: 11Polar Surface Area: 85.99Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.54CX LogP: 3.43CX LogD: 3.39Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.38
References 1. Kraupner N, Dinh CP, Wen X, Landry V, Herledan A, Leroux F, Bosc D, Charton J, Maillard C, Warenghem S, Duplan I, Piveteau C, Hennuyer N, Staels B, Deprez B, Deprez-Poulain R.. (2022) Identification of indole-based activators of insulin degrading enzyme., 228 [PMID:34815130 ] [10.1016/j.ejmech.2021.113982 ]