The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-hydroxy-4-((4-(4-(4-methoxyphenyl)-1H-1,2,3-triazol-1-yl)phenyl)sulfonyl)tetrahydro-2H-pyran-4-carboxamide ID: ALA5199189
PubChem CID: 45280173
Max Phase: Preclinical
Molecular Formula: C21H22N4O6S
Molecular Weight: 458.50
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cn(-c3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)nn2)cc1
Standard InChI: InChI=1S/C21H22N4O6S/c1-30-17-6-2-15(3-7-17)19-14-25(24-22-19)16-4-8-18(9-5-16)32(28,29)21(20(26)23-27)10-12-31-13-11-21/h2-9,14,27H,10-13H2,1H3,(H,23,26)
Standard InChI Key: JHSGRRNCQDDQBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-0.9676 1.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2530 2.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4588 1.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4588 1.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2511 0.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9676 1.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1735 0.6864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9269 1.0218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4789 0.4089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0665 -0.3053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2596 -0.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4788 -1.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3035 -1.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7139 -1.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3015 -2.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4810 -2.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0647 -1.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6817 2.3361 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3960 1.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1101 2.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8243 1.9237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5385 2.3361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1101 3.1608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0941 3.0503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2694 3.0503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6818 1.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6818 0.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3960 0.2743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1101 0.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1101 1.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7139 -3.1608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5385 -3.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 4 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 7 1 0
12 10 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
12 17 1 0
17 16 2 0
1 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 2 0
18 24 2 0
18 25 2 0
19 26 1 0
27 26 1 0
28 27 1 0
29 28 1 0
30 29 1 0
19 30 1 0
31 15 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.50Molecular Weight (Monoisotopic): 458.1260AlogP: 1.77#Rotatable Bonds: 6Polar Surface Area: 132.64Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.66CX Basic pKa: ┄CX LogP: 1.71CX LogD: 1.68Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -1.40
References 1. Baidya SK, Banerjee S, Adhikari N, Jha T.. (2022) Selective Inhibitors of Medium-Size S1' Pocket Matrix Metalloproteinases: A Stepping Stone of Future Drug Discovery., 65 (16.0): [PMID:35969157 ] [10.1021/acs.jmedchem.1c01855 ]