Brasilianoid L

ID: ALA5199266

PubChem CID: 146682199

Max Phase: Preclinical

Molecular Formula: C25H30O6

Molecular Weight: 426.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1[C@@]2(C)C[C@H]3C(=C)[C@]4(C=CC(=O)OC4(C)C)CC[C@]3(C)[C@@]13C(=O)O[C@@H](C)[C@@]3(O)C2=O

Standard InChI:  InChI=1S/C25H30O6/c1-13-16-12-21(6)14(2)24(19(28)30-15(3)25(24,29)18(21)27)22(16,7)10-11-23(13)9-8-17(26)31-20(23,4)5/h8-9,15-16,29H,1-2,10-12H2,3-7H3/t15-,16-,21+,22-,23-,24-,25+/m0/s1

Standard InChI Key:  YJDXBOGRIUMCLZ-ZLRFBPIASA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -0.7773   -0.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0628   -1.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7772   -0.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0628    0.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6515   -0.1335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6514   -0.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1902    1.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3642    1.7020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1934    1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6628    0.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4247    0.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7773   -1.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4915   -2.1954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2057   -1.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2057   -0.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4915   -0.5461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5076    0.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7714    0.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1060   -0.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6058    2.3615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9199    1.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1060   -1.1116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3657   -0.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0628   -0.5457    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9199   -2.1954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3642   -2.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0473   -1.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4915    0.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1508    2.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1326    1.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0751    0.2538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8468    1.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  2  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5 11  1  0
 11 10  1  0
  1 12  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
  1 16  1  1
 10 17  1  0
 17 18  1  0
 19 18  1  0
 11 19  1  0
  9 20  2  0
 17 21  1  6
 19 22  2  0
  5 23  1  6
  4 24  1  1
 14 25  2  0
 12 26  1  0
 12 27  1  0
  3 28  2  0
  8 29  1  6
  8 30  1  0
 11 30  1  6
 10 31  1  1
 30 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5199266

    ---

Associated Targets(non-human)

IEC-6 (77 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.51Molecular Weight (Monoisotopic): 426.2042AlogP: 3.05#Rotatable Bonds:
Polar Surface Area: 89.90Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.44CX Basic pKa: CX LogP: 3.30CX LogD: 3.30
Aromatic Rings: Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: 2.38

References

1. Zhao M, Tang Y, Xie J, Zhao Z, Cui H..  (2021)  Meroterpenoids produced by fungi: Occurrence, structural diversity, biological activities, and their molecular targets.,  209  [PMID:33032085] [10.1016/j.ejmech.2020.112860]

Source