The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Brasilianoid L ID: ALA5199266
PubChem CID: 146682199
Max Phase: Preclinical
Molecular Formula: C25H30O6
Molecular Weight: 426.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1[C@@]2(C)C[C@H]3C(=C)[C@]4(C=CC(=O)OC4(C)C)CC[C@]3(C)[C@@]13C(=O)O[C@@H](C)[C@@]3(O)C2=O
Standard InChI: InChI=1S/C25H30O6/c1-13-16-12-21(6)14(2)24(19(28)30-15(3)25(24,29)18(21)27)22(16,7)10-11-23(13)9-8-17(26)31-20(23,4)5/h8-9,15-16,29H,1-2,10-12H2,3-7H3/t15-,16-,21+,22-,23-,24-,25+/m0/s1
Standard InChI Key: YJDXBOGRIUMCLZ-ZLRFBPIASA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-0.7773 -0.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0628 -1.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7772 -0.1334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0628 0.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6515 -0.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6514 -0.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1902 1.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3642 1.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1934 1.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6628 0.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4247 0.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7773 -1.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4915 -2.1954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2057 -1.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2057 -0.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4915 -0.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5076 0.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7714 0.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1060 -0.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6058 2.3615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9199 1.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1060 -1.1116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3657 -0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0628 -0.5457 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9199 -2.1954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3642 -2.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0473 -1.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4915 0.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1508 2.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1326 1.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0751 0.2538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8468 1.5311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
4 3 1 0
5 4 1 0
6 5 1 0
2 6 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
5 11 1 0
11 10 1 0
1 12 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 2 0
1 16 1 1
10 17 1 0
17 18 1 0
19 18 1 0
11 19 1 0
9 20 2 0
17 21 1 6
19 22 2 0
5 23 1 6
4 24 1 1
14 25 2 0
12 26 1 0
12 27 1 0
3 28 2 0
8 29 1 6
8 30 1 0
11 30 1 6
10 31 1 1
30 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.51Molecular Weight (Monoisotopic): 426.2042AlogP: 3.05#Rotatable Bonds: ┄Polar Surface Area: 89.90Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.44CX Basic pKa: ┄CX LogP: 3.30CX LogD: 3.30Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: 2.38
References 1. Zhao M, Tang Y, Xie J, Zhao Z, Cui H.. (2021) Meroterpenoids produced by fungi: Occurrence, structural diversity, biological activities, and their molecular targets., 209 [PMID:33032085 ] [10.1016/j.ejmech.2020.112860 ]