The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(2-methoxyphenyl)-4-oxothiazolidin-2-yl)-N-(4-(4-chlorophenyl)butyl)benzamide ID: ALA5199319
PubChem CID: 168290938
Max Phase: Preclinical
Molecular Formula: C27H27ClN2O3S
Molecular Weight: 495.04
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1C(=O)CSC1c1cccc(C(=O)NCCCCc2ccc(Cl)cc2)c1
Standard InChI: InChI=1S/C27H27ClN2O3S/c1-33-24-11-3-2-10-23(24)30-25(31)18-34-27(30)21-9-6-8-20(17-21)26(32)29-16-5-4-7-19-12-14-22(28)15-13-19/h2-3,6,8-15,17,27H,4-5,7,16,18H2,1H3,(H,29,32)
Standard InChI Key: WVBLFTIUWULNJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-1.7802 -2.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9541 -1.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7438 -0.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3592 -1.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1867 -2.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3908 -2.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3394 -0.6827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5312 -0.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1897 -1.6118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1159 -0.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6719 0.4814 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.4275 0.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1459 0.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1459 1.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8681 1.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8681 2.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5902 3.0404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1567 3.0423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4382 2.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7190 3.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0004 2.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 3.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4372 2.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4372 1.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1556 1.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8720 1.8169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8720 2.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1506 3.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5902 1.4023 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.5853 1.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5853 0.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8655 0.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9791 -2.2598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7645 -3.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
6 1 2 0
5 6 1 0
7 2 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
13 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
26 29 1 0
15 30 1 0
30 31 2 0
32 13 2 0
31 32 1 0
1 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.04Molecular Weight (Monoisotopic): 494.1431AlogP: 5.88#Rotatable Bonds: 9Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.60CX LogD: 5.60Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.03
References 1. Deng Y, Pi R, Niu L, Zhao Y, Ni D, Song L, Li Z, Han W, Wei Q, Han Y, Zhu T, Luo Z, Sun D, Dong S, Liu S.. (2022) Novel 2-phenyl-3-(Pyridin-2-yl) thiazolidin-4-one derivatives as potent inhibitors for proliferation of osteosarcoma cells in vitro and in vivo., 228 [PMID:34861640 ] [10.1016/j.ejmech.2021.114010 ]