N-acetyl-O-(((R)-3-(3-(2-(heptyloxy)phenyl)propanamido)-2-methylpropoxy)(hydroxy)phosphoryl)-L-serine

ID: ALA5199515

PubChem CID: 168291465

Max Phase: Preclinical

Molecular Formula: C25H41N2O9P

Molecular Weight: 544.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCOc1ccccc1CCC(=O)NC[C@@H](C)COP(=O)(O)OC[C@H](NC(C)=O)C(=O)O

Standard InChI:  InChI=1S/C25H41N2O9P/c1-4-5-6-7-10-15-34-23-12-9-8-11-21(23)13-14-24(29)26-16-19(2)17-35-37(32,33)36-18-22(25(30)31)27-20(3)28/h8-9,11-12,19,22H,4-7,10,13-18H2,1-3H3,(H,26,29)(H,27,28)(H,30,31)(H,32,33)/t19-,22+/m1/s1

Standard InChI Key:  YDBAEHJGQNWXEY-KNQAVFIVSA-N

Molfile:  

 
     RDKit          2D

 37 37  0  0  0  0  0  0  0  0999 V2000
    2.1351    0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1351   -0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8485   -1.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5557   -0.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5557    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8467    0.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8467    1.4379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5584    1.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2701    1.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9818    1.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6934    1.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4051    1.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1169    1.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8285    1.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4233    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7116    0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7115    0.2056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4232    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1350    0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8466    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5584    0.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2701    0.6164    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9818    0.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6934    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4051    0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1168    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8285    0.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1168    1.4382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4051   -0.6161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1168   -1.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1168   -1.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8285   -0.6161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8583    1.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6801    1.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1350   -0.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  1 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 26 30  1  6
 30 31  1  0
 31 32  1  0
 31 33  2  0
 23 34  1  0
 23 35  2  0
 20 36  1  1
 17 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5199515

    ---

Associated Targets(non-human)

Gpr174 Probable G-protein coupled receptor 174 (140 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.58Molecular Weight (Monoisotopic): 544.2550AlogP: 3.44#Rotatable Bonds: 20
Polar Surface Area: 160.49Molecular Species: ACIDHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.91CX Basic pKa: CX LogP: 2.79CX LogD: -2.85
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.14Np Likeness Score: -0.02

References

1. Sayama M, Uwamizu A, Ikubo M, Chen L, Yan G, Otani Y, Inoue A, Aoki J, Ohwada T..  (2021)  Switching Lysophosphatidylserine G Protein-Coupled Receptor Agonists to Antagonists by Acylation of the Hydrophilic Serine Amine.,  64  (14.0): [PMID:34233115] [10.1021/acs.jmedchem.1c00347]

Source