sodium 2-(2-(2-(4-benzhydrylpiperazin-1-yl)-2-oxoethoxy)acetamido)-5-chlorobenzoate

ID: ALA5200284

Cas Number: 1103926-82-4

PubChem CID: 53240409

Product Number: T287019, Order Now?

Max Phase: Preclinical

Molecular Formula: C28H27ClN3NaO5

Molecular Weight: 522.00

Associated Items:

This product is in stock

Names and Identifiers

Canonical SMILES:  O=C(COCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)Nc1ccc(Cl)cc1C(=O)[O-].[Na+]

Standard InChI:  InChI=1S/C28H28ClN3O5.Na/c29-22-11-12-24(23(17-22)28(35)36)30-25(33)18-37-19-26(34)31-13-15-32(16-14-31)27(20-7-3-1-4-8-20)21-9-5-2-6-10-21;/h1-12,17,27H,13-16,18-19H2,(H,30,33)(H,35,36);/q;+1/p-1

Standard InChI Key:  JSHSGBIWNPQCQZ-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   -4.9998   -1.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2852   -1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5733   -1.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5733   -2.2663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2834   -2.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9998   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8587   -1.0285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1441   -1.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294   -1.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1441   -2.2663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148   -1.4411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -1.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -1.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290   -1.0285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -2.2663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2852   -0.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9998    0.2085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5706    0.2085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290   -0.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1436    0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -0.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -1.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1436   -1.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5729    0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5729    1.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -0.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584    1.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8591    2.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5739    2.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2859    2.2734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2906    1.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0023    0.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7144   -0.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7144   -1.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0042   -1.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7144   -2.6826    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.7025    0.6374    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
  2 16  1  0
 16 17  2  0
 16 18  1  0
 19 14  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 14 23  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 27 25  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 25 31  1  0
 32 26  2  0
 33 32  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 26 36  1  0
  6 37  1  0
M  CHG  2  18  -1  38   1
M  END

Associated Targets(non-human)

Blood (1237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Blood (1 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.00Molecular Weight (Monoisotopic): 521.1717AlogP: 3.93#Rotatable Bonds: 9
Polar Surface Area: 99.18Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.37CX Basic pKa: 7.17CX LogP: 1.72CX LogD: 1.39
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -1.38

References

1. Li X, Guo T, Feng Q, Bai T, Wu L, Liu Y, Zheng X, Jia J, Pei J, Wu S, Song Y, Zhang Y..  (2022)  Progress of thrombus formation and research on the structure-activity relationship for antithrombotic drugs.,  228  [PMID:34902735] [10.1016/j.ejmech.2021.114035]

Source