3-(((S)-3-((S)-2-((2,3-Dihydro-1H-inden-2-yl)carbamoyl)-pyrrolidin-1-yl)-2-((S)-2-(methylamino)propanamido)-3-oxopropyl)carbamoyl)-4-methoxybenzenesulfonyl Fluoride

ID: ALA5200297

PubChem CID: 168290546

Max Phase: Preclinical

Molecular Formula: C28H34FN5O6S

Molecular Weight: 587.67

Associated Items:

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@@H](CNC(=O)c1cccc(S(=O)(=O)F)c1)C(=O)N1CCC[C@H]1C(=O)NC1Cc2ccccc2C1

Standard InChI:  InChI=1S/C28H34FN5O6S/c1-17(30-2)25(35)33-23(16-31-26(36)20-9-5-10-22(15-20)41(29,39)40)28(38)34-12-6-11-24(34)27(37)32-21-13-18-7-3-4-8-19(18)14-21/h3-5,7-10,15,17,21,23-24,30H,6,11-14,16H2,1-2H3,(H,31,36)(H,32,37)(H,33,35)/t17-,23-,24-/m0/s1

Standard InChI Key:  CEOLXASLSSYUAD-DPSWKAHMSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
    0.7740  -23.5533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1904  -22.8411    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.3654  -22.8366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8942  -20.7964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6126  -20.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1760  -20.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6126  -19.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3308  -20.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3308  -21.6251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0491  -20.3798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7632  -20.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4815  -20.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1997  -20.7964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4815  -19.5511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7611  -21.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9567  -20.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0460  -22.0321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0440  -22.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3289  -23.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7571  -23.2708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6184  -22.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9037  -23.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9013  -24.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6194  -24.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3311  -24.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1251  -19.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9085  -19.3880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5103  -19.0963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5233  -19.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4441  -20.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3330  -19.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7481  -20.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1977  -21.0849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4533  -21.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2588  -22.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8084  -21.4175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5498  -20.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1933  -22.0199    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.2972  -21.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1054  -21.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5129  -21.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  6  1  0
  5  7  1  1
  5  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 11 15  1  6
 16 13  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
 16 26  1  6
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  1  0
 30 33  1  0
 32 31  1  0
 31 29  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 22  2  1  0
  2 38  1  0
 39 40  1  0
 40 41  1  0
 13 39  1  0
 16 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5200297

    ---

Associated Targets(Human)

BIRC7 Tchem Baculoviral IAP repeat-containing protein 7 (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC2 Tchem Baculoviral IAP repeat-containing protein 2 (984 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC3 Tchem Baculoviral IAP repeat-containing protein 3 (320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.67Molecular Weight (Monoisotopic): 587.2214AlogP: 0.44#Rotatable Bonds: 10
Polar Surface Area: 153.78Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.61CX Basic pKa: 8.60CX LogP: 0.76CX LogD: -0.46
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.29Np Likeness Score: -0.68

References

1. Udompholkul P, Baggio C, Gambini L, Alboreggia G, Pellecchia M..  (2021)  Lysine Covalent Antagonists of Melanoma Inhibitors of Apoptosis Protein.,  64  (21.0): [PMID:34705456] [10.1021/acs.jmedchem.1c01459]

Source