(R)-4-(2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(1-methyl-1H-pyrazol-5-yl)quinazolin-4-yl)-3-methylmorpholine

ID: ALA5200343

PubChem CID: 168291278

Max Phase: Preclinical

Molecular Formula: C24H22FN7O

Molecular Weight: 443.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1COCCN1c1nc(-c2c[nH]c3ncc(F)cc23)nc2ccc(-c3ccnn3C)cc12

Standard InChI:  InChI=1S/C24H22FN7O/c1-14-13-33-8-7-32(14)24-18-9-15(21-5-6-28-31(21)2)3-4-20(18)29-23(30-24)19-12-27-22-17(19)10-16(25)11-26-22/h3-6,9-12,14H,7-8,13H2,1-2H3,(H,26,27)/t14-/m1/s1

Standard InChI Key:  SNUWRWVDGRZKGQ-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    1.3874    3.4902    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9372    2.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6806    2.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2321    1.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0397    1.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3046    2.4276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7492    3.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4527    0.9271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9006    0.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1461    0.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318    0.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7122    0.6523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005    0.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -0.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -1.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318   -0.5934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -1.8318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012   -2.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012   -3.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7142   -3.4902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4299   -3.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4299   -2.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7151   -1.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7176   -1.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4336   -0.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4336    0.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7176    0.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1474   -1.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9004   -0.6721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4527   -1.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0404   -2.0028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2299   -1.8299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6154   -2.3804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  2  7  2  0
  6  7  1  0
  8  5  1  0
  8  9  1  0
 10  9  2  0
 10  4  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 14 15  1  0
 11 16  1  0
 16 15  2  0
 15 17  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 20 21  1  0
 17 22  1  0
 22 21  1  0
 18 23  1  1
 14 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 13 27  1  0
 28 25  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 32 28  1  0
 33 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5200343

    ---

Associated Targets(Human)

ATR Tchem Serine-protein kinase ATR (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.49Molecular Weight (Monoisotopic): 443.1870AlogP: 3.94#Rotatable Bonds: 3
Polar Surface Area: 84.75Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.69CX Basic pKa: 4.28CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.44

References

1. Bin H, Chen P, Wu M, Wang F, Lin G, Pan S, Liu J, Mu B, Nan J, Huang Q, Li L, Yang S..  (2022)  Discovery of a potent and highly selective inhibitor of ataxia telangiectasia mutated and Rad3-Related (ATR) kinase: Structural activity relationship and antitumor activity both in vitro and in vivo.,  232  [PMID:35183872] [10.1016/j.ejmech.2022.114187]

Source