The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(biphenyl-4-ylmethylamino)ethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide ID: ALA5200401
PubChem CID: 168290572
Max Phase: Preclinical
Molecular Formula: C23H20F6N2O2S
Molecular Weight: 502.48
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NCCNCc1ccc(-c2ccccc2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C23H20F6N2O2S/c24-22(25,26)19-12-20(23(27,28)29)14-21(13-19)34(32,33)31-11-10-30-15-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-9,12-14,30-31H,10-11,15H2
Standard InChI Key: KHVMWFCOEVLSRH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
0.7151 0.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0006 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7138 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4282 0.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1427 0.4134 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.8572 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8574 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5701 -1.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2847 -0.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2863 -0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5746 0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0008 0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7152 -0.0011 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0008 1.2363 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.7152 0.8238 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5701 -2.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8556 -2.4721 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.2845 -2.4721 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5701 -2.8846 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7294 1.1293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5544 1.1293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1442 1.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8569 1.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5716 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5732 0.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8616 -0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2861 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2863 2.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9990 2.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7137 2.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7152 1.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0036 1.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
10 12 1 0
12 13 1 0
12 14 1 0
12 15 1 0
8 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
5 20 2 0
5 21 2 0
1 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
29 26 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
29 34 1 0
34 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.48Molecular Weight (Monoisotopic): 502.1150AlogP: 5.46#Rotatable Bonds: 8Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.81CX Basic pKa: 8.09CX LogP: 5.46CX LogD: 4.78Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.14
References 1. Sun J, Ambrus JI, Baker JR, Russell CC, Cossar PJ, Sakoff JA, Scarlett CJ, McCluskey A.. (2022) 3,5-Bis(trifluoromethyl)phenylsulfonamides, a novel pancreatic cancer active lead. Investigation of the terminal aromatic moiety., 61 [PMID:35114371 ] [10.1016/j.bmcl.2022.128591 ]