(6-((4-(Benzo[d][1,3]dioxol-5-yl)-5-fluoropyrimidin-2-yl)amino)pyridin-3-yl)(4-ethylpiperazin-1-yl)methanone

ID: ALA5200408

PubChem CID: 168290762

Max Phase: Preclinical

Molecular Formula: C23H23FN6O3

Molecular Weight: 450.47

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN1CCN(C(=O)c2ccc(Nc3ncc(F)c(-c4ccc5c(c4)OCO5)n3)nc2)CC1

Standard InChI:  InChI=1S/C23H23FN6O3/c1-2-29-7-9-30(10-8-29)22(31)16-4-6-20(25-12-16)27-23-26-13-17(24)21(28-23)15-3-5-18-19(11-15)33-14-32-18/h3-6,11-13H,2,7-10,14H2,1H3,(H,25,26,27,28)

Standard InChI Key:  AORLTNNDHWCLMA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -1.7045    0.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9899    1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2780    0.6176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2780   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9881   -0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7045   -0.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4365   -0.6201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1511   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1514    0.6176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8643    1.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5791    0.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5807   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8689   -0.6219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2936    1.0282    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4190    1.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1338    0.6172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1338   -0.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8484   -0.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5630   -0.2078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5630    0.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8484    1.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4190    1.8549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2777   -0.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9922   -0.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2953   -0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0101   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7222   -0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7222   -1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0119   -1.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2953   -1.4467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5071   -1.6981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5071   -0.3626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9922   -1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 11 14  1  0
  1 15  1  0
 15 16  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 16 21  1  0
 15 22  2  0
 19 23  1  0
 23 24  1  0
 12 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 28 31  1  0
 27 32  1  0
 32 33  1  0
 33 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5200408

    ---

Associated Targets(Human)

CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.47Molecular Weight (Monoisotopic): 450.1816AlogP: 2.93#Rotatable Bonds: 5
Polar Surface Area: 92.71Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.63CX Basic pKa: 7.04CX LogP: 2.85CX LogD: 2.69
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: -1.51

References

1. Chen W, Ji M, Cheng H, Zheng M, Xia F, Min W, Yang H, Wang X, Wang L, Cao L, Yuan K, Yang P..  (2022)  Discovery, Optimization, and Evaluation of Selective CDK4/6 Inhibitors for the Treatment of Breast Cancer.,  65  (22.0): [PMID:36350721] [10.1021/acs.jmedchem.2c00947]

Source