1-(4-(6-(3-Fluorophenyl)-2-(3-hydroxypropyl)-2H-indazol-3-yl)piperazin-1-yl)prop-2-en-1-one

ID: ALA5200494

PubChem CID: 168290765

Max Phase: Preclinical

Molecular Formula: C23H25FN4O2

Molecular Weight: 408.48

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1CCN(c2c3ccc(-c4cccc(F)c4)cc3nn2CCCO)CC1

Standard InChI:  InChI=1S/C23H25FN4O2/c1-2-22(30)26-10-12-27(13-11-26)23-20-8-7-18(17-5-3-6-19(24)15-17)16-21(20)25-28(23)9-4-14-29/h2-3,5-8,15-16,29H,1,4,9-14H2

Standard InChI Key:  HSZMCLVZKZIWPW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -2.9544    4.0513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9544    3.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2314    2.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2314    1.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9471    1.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6701    1.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6701    2.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5157    1.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5157    0.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7996    0.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0835    0.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0835    1.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7996    1.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7066    1.8371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1950    1.1651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7066    0.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9615   -0.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7689   -0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0251   -1.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4739   -1.8690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6639   -1.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4078   -0.9033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7287   -2.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1768   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4316   -4.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5358   -2.8252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0200    1.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4325    0.4507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2575    0.4507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6701   -0.2637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  2  0
  4  5  1  0
  6  5  2  0
  2  7  2  0
  7  6  1  0
  4  8  1  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 11 12  1  0
  8 13  2  0
 12 13  1  0
 12 14  2  0
 14 15  1  0
 15 16  1  0
 11 16  2  0
 16 17  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 20 21  1  0
 17 22  1  0
 22 21  1  0
 20 23  1  0
 23 24  1  0
 24 25  2  0
 23 26  2  0
 27 15  1  0
 27 28  1  0
 28 29  1  0
 30 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5200494

    ---

Associated Targets(Human)

BCL2A1 Tchem Bcl-2-related protein A1 (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.48Molecular Weight (Monoisotopic): 408.1962AlogP: 3.06#Rotatable Bonds: 6
Polar Surface Area: 61.60Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.56CX LogP: 2.96CX LogD: 2.96
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -1.06

References

1. Feng X, Yan Z, Zhou F, Lou J, Lyu X, Ren X, Zeng Z, Liu C, Zhang S, Zhu D, Huang H, Yang J, Zhao Y..  (2022)  Discovery of a selective and covalent small-molecule inhibitor of BFL-1 protein that induces robust apoptosis in cancer cells.,  236  [PMID:35385805] [10.1016/j.ejmech.2022.114327]

Source