The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(6-(3-Fluorophenyl)-2-(3-hydroxypropyl)-2H-indazol-3-yl)piperazin-1-yl)prop-2-en-1-one ID: ALA5200494
PubChem CID: 168290765
Max Phase: Preclinical
Molecular Formula: C23H25FN4O2
Molecular Weight: 408.48
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCN(c2c3ccc(-c4cccc(F)c4)cc3nn2CCCO)CC1
Standard InChI: InChI=1S/C23H25FN4O2/c1-2-22(30)26-10-12-27(13-11-26)23-20-8-7-18(17-5-3-6-19(24)15-17)16-21(20)25-28(23)9-4-14-29/h2-3,5-8,15-16,29H,1,4,9-14H2
Standard InChI Key: HSZMCLVZKZIWPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-2.9544 4.0513 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.9544 3.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2314 2.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2314 1.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9471 1.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6701 1.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6701 2.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5157 1.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5157 0.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7996 0.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0835 0.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0835 1.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7996 1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7066 1.8371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1950 1.1651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7066 0.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9615 -0.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7689 -0.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0251 -1.2496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4739 -1.8690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6639 -1.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4078 -0.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7287 -2.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1768 -3.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4316 -4.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5358 -2.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0200 1.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4325 0.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2575 0.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6701 -0.2637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 2 0
4 5 1 0
6 5 2 0
2 7 2 0
7 6 1 0
4 8 1 0
9 8 1 0
10 9 2 0
11 10 1 0
11 12 1 0
8 13 2 0
12 13 1 0
12 14 2 0
14 15 1 0
15 16 1 0
11 16 2 0
16 17 1 0
18 17 1 0
19 18 1 0
20 19 1 0
20 21 1 0
17 22 1 0
22 21 1 0
20 23 1 0
23 24 1 0
24 25 2 0
23 26 2 0
27 15 1 0
27 28 1 0
28 29 1 0
30 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.48Molecular Weight (Monoisotopic): 408.1962AlogP: 3.06#Rotatable Bonds: 6Polar Surface Area: 61.60Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.56CX LogP: 2.96CX LogD: 2.96Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -1.06
References 1. Feng X, Yan Z, Zhou F, Lou J, Lyu X, Ren X, Zeng Z, Liu C, Zhang S, Zhu D, Huang H, Yang J, Zhao Y.. (2022) Discovery of a selective and covalent small-molecule inhibitor of BFL-1 protein that induces robust apoptosis in cancer cells., 236 [PMID:35385805 ] [10.1016/j.ejmech.2022.114327 ]