(S)-N-(3-amino-3-oxo-2-(2-((2-oxo-2H-chromen-7-yl)oxy)acetamido)propyl)-1,4-dioxo-1,2,3,4-tetrahydrophthalazine-6-carboxamide

ID: ALA5200663

PubChem CID: 168290777

Max Phase: Preclinical

Molecular Formula: C23H19N5O8

Molecular Weight: 493.43

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)[C@H](CNC(=O)c1ccc2c(=O)[nH][nH]c(=O)c2c1)NC(=O)COc1ccc2ccc(=O)oc2c1

Standard InChI:  InChI=1S/C23H19N5O8/c24-20(31)16(9-25-21(32)12-2-5-14-15(7-12)23(34)28-27-22(14)33)26-18(29)10-35-13-4-1-11-3-6-19(30)36-17(11)8-13/h1-8,16H,9-10H2,(H2,24,31)(H,25,32)(H,26,29)(H,27,33)(H,28,34)/t16-/m0/s1

Standard InChI Key:  NWZSBFOFRLRTTM-INIZCTEOSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    3.5711    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2857    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9976    0.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9976   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -0.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5711   -0.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7122    1.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4269    0.6197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4269   -0.2053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7122   -0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7122    1.8575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7122   -1.4431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565   -0.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565   -1.4468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1419   -0.2090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4272   -0.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125   -0.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0019   -0.6215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125    0.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0019    1.0287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4272    1.0287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7166   -0.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4313   -0.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7166    0.6161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1458   -0.2090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8605   -0.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8607   -1.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5736   -1.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2885   -1.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2900   -0.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5782   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9987   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7107   -1.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7122   -0.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0020   -0.2145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4269   -0.2139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  7 11  2  0
 10 12  2  0
  6 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 17 16  1  6
 17 18  1  0
 17 19  1  0
 19 20  2  0
 19 21  1  0
 18 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 29 32  1  0
 33 32  2  0
 34 33  1  0
 35 34  1  0
 30 35  1  0
 34 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5200663

    ---

Associated Targets(Human)

PARP15 Tchem Poly [ADP-ribose] polymerase 15 (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 493.43Molecular Weight (Monoisotopic): 493.1234AlogP: -0.90#Rotatable Bonds: 8
Polar Surface Area: 206.45Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.79CX Basic pKa: CX LogP: -1.58CX LogD: -1.71
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.19Np Likeness Score: -0.52

References

1. Nizi MG, Maksimainen MM, Lehtiö L, Tabarrini O..  (2022)  Medicinal Chemistry Perspective on Targeting Mono-ADP-Ribosylating PARPs with Small Molecules.,  65  (11.0): [PMID:35608571] [10.1021/acs.jmedchem.2c00281]

Source