The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-amino-3-oxo-2-(2-((2-oxo-2H-chromen-7-yl)oxy)acetamido)propyl)-1,4-dioxo-1,2,3,4-tetrahydrophthalazine-6-carboxamide ID: ALA5200663
PubChem CID: 168290777
Max Phase: Preclinical
Molecular Formula: C23H19N5O8
Molecular Weight: 493.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](CNC(=O)c1ccc2c(=O)[nH][nH]c(=O)c2c1)NC(=O)COc1ccc2ccc(=O)oc2c1
Standard InChI: InChI=1S/C23H19N5O8/c24-20(31)16(9-25-21(32)12-2-5-14-15(7-12)23(34)28-27-22(14)33)26-18(29)10-35-13-4-1-11-3-6-19(30)36-17(11)8-13/h1-8,16H,9-10H2,(H2,24,31)(H,25,32)(H,26,29)(H,27,33)(H,28,34)/t16-/m0/s1
Standard InChI Key: NWZSBFOFRLRTTM-INIZCTEOSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.5711 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9976 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9976 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2875 -0.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5711 -0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7122 1.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4269 0.6197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4269 -0.2053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7122 -0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7122 1.8575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7122 -1.4431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 -0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 -1.4468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1419 -0.2090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4272 -0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7125 -0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0019 -0.6215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7125 0.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0019 1.0287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4272 1.0287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7166 -0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4313 -0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7166 0.6161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1458 -0.2090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8605 -0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8607 -1.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5736 -1.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2885 -1.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2900 -0.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5782 -0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9987 -1.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7107 -1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7122 -0.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0020 -0.2145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4269 -0.2139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
4 10 1 0
7 11 2 0
10 12 2 0
6 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
17 16 1 6
17 18 1 0
17 19 1 0
19 20 2 0
19 21 1 0
18 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
29 32 1 0
33 32 2 0
34 33 1 0
35 34 1 0
30 35 1 0
34 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.43Molecular Weight (Monoisotopic): 493.1234AlogP: -0.90#Rotatable Bonds: 8Polar Surface Area: 206.45Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.79CX Basic pKa: ┄CX LogP: -1.58CX LogD: -1.71Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.19Np Likeness Score: -0.52
References 1. Nizi MG, Maksimainen MM, Lehtiö L, Tabarrini O.. (2022) Medicinal Chemistry Perspective on Targeting Mono-ADP-Ribosylating PARPs with Small Molecules., 65 (11.0): [PMID:35608571 ] [10.1021/acs.jmedchem.2c00281 ]