(S)-3-(3',5'-dichloro-4'-methoxybiphenyl-3-yl)-2-(5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamido)propanoic acid

ID: ALA5200679

PubChem CID: 168290785

Max Phase: Preclinical

Molecular Formula: C25H21Cl2N3O5

Molecular Weight: 514.37

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(Cl)cc(-c2cccc(C[C@H](NC(=O)c3cc(-c4ccc(C)o4)[nH]n3)C(=O)O)c2)cc1Cl

Standard InChI:  InChI=1S/C25H21Cl2N3O5/c1-13-6-7-22(35-13)19-12-20(30-29-19)24(31)28-21(25(32)33)9-14-4-3-5-15(8-14)16-10-17(26)23(34-2)18(27)11-16/h3-8,10-12,21H,9H2,1-2H3,(H,28,31)(H,29,30)(H,32,33)/t21-/m0/s1

Standard InChI Key:  NKUFZFKCAIBESU-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    5.6139  -17.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2052  -16.8267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1950  -18.2541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3716  -18.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9568  -18.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9670  -17.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3818  -16.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1436  -17.5256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3613  -19.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9425  -20.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3464  -21.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1708  -21.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5895  -20.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1792  -19.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4374  -17.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9190  -18.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7040  -17.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7099  -17.1431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9285  -16.8831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3645  -18.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3587  -19.2689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1360  -19.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6224  -18.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1455  -18.2020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3836  -20.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9340  -21.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1136  -21.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6977  -22.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1011  -23.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9246  -23.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3368  -22.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3305  -23.9267    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.8784  -22.4884    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.6861  -23.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667  -23.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  1  1
  4  6  1  0
  6  7  2  0
  6  8  1  0
  5  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 15  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 20  2  0
 17 20  1  0
 22 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 11 26  1  0
 30 32  1  0
 28 33  1  0
 29 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5200679

    ---

Associated Targets(Human)

ALPP Tbio Alkaline phosphatase placental type (103 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.37Molecular Weight (Monoisotopic): 513.0858AlogP: 5.39#Rotatable Bonds: 8
Polar Surface Area: 117.45Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.12CX Basic pKa: 0.05CX LogP: 4.97CX LogD: 1.86
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.89

References

1. Bassi G, Favalli N, Pellegrino C, Onda Y, Scheuermann J, Cazzamalli S, Manz MG, Neri D..  (2021)  Specific Inhibitor of Placental Alkaline Phosphatase Isolated from a DNA-Encoded Chemical Library Targets Tumor of the Female Reproductive Tract.,  64  (21.0): [PMID:34709820] [10.1021/acs.jmedchem.1c01103]

Source