Methyl ((2-isobutyl-4-(4-((2-isopropyl-1H-imidazol-1-yl)methyl)phenyl)thiazol-5-yl) sulfonyl)carbamate

ID: ALA5200682

PubChem CID: 166492466

Max Phase: Preclinical

Molecular Formula: C22H28N4O4S2

Molecular Weight: 476.62

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)NS(=O)(=O)c1sc(CC(C)C)nc1-c1ccc(Cn2ccnc2C(C)C)cc1

Standard InChI:  InChI=1S/C22H28N4O4S2/c1-14(2)12-18-24-19(21(31-18)32(28,29)25-22(27)30-5)17-8-6-16(7-9-17)13-26-11-10-23-20(26)15(3)4/h6-11,14-15H,12-13H2,1-5H3,(H,25,27)

Standard InChI Key:  CZWYKUJDHGUYSL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   -1.1807   -2.5320    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9303   -1.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1332   -1.5324    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.4502   -2.1159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2473   -1.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8308   -2.4859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6279   -2.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4609   -1.1052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3468   -0.7352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4512   -0.9477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6005   -1.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2651   -1.7536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0057   -2.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4868   -3.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1469   -3.9587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3259   -4.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6279   -4.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6052   -0.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8932   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8979    0.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6148    1.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6195    2.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9074    2.4514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1519    2.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3966    2.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0200    3.4486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8259    3.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4422    3.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2753    4.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2253    3.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3268    0.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3221   -0.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  5  8  2  0
  3  9  2  0
  3 10  2  0
 11  2  2  0
 12 11  1  0
 13 12  2  0
  1 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 11 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 27 23  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 21 31  2  0
 31 32  1  0
 32 18  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5200682

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Tclin Type-1 angiotensin II receptor (5176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.62Molecular Weight (Monoisotopic): 476.1552AlogP: 4.42#Rotatable Bonds: 8
Polar Surface Area: 103.18Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.57CX Basic pKa: 6.79CX LogP: 3.29CX LogD: 3.77
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.24

References

1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M..  (2022)  Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds.,  65  [PMID:35550979] [10.1016/j.bmc.2022.116790]

Source