The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl ((2-isobutyl-4-(4-((2-isopropyl-1H-imidazol-1-yl)methyl)phenyl)thiazol-5-yl) sulfonyl)carbamate ID: ALA5200682
PubChem CID: 166492466
Max Phase: Preclinical
Molecular Formula: C22H28N4O4S2
Molecular Weight: 476.62
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)NS(=O)(=O)c1sc(CC(C)C)nc1-c1ccc(Cn2ccnc2C(C)C)cc1
Standard InChI: InChI=1S/C22H28N4O4S2/c1-14(2)12-18-24-19(21(31-18)32(28,29)25-22(27)30-5)17-8-6-16(7-9-17)13-26-11-10-23-20(26)15(3)4/h6-11,14-15H,12-13H2,1-5H3,(H,25,27)
Standard InChI Key: CZWYKUJDHGUYSL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-1.1807 -2.5320 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.9303 -1.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1332 -1.5324 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.4502 -2.1159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2473 -1.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8308 -2.4859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6279 -2.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4609 -1.1052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3468 -0.7352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4512 -0.9477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6005 -1.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2651 -1.7536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0057 -2.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4868 -3.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1469 -3.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3259 -4.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6279 -4.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6052 -0.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8932 -0.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8979 0.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6148 1.2099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6195 2.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9074 2.4514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1519 2.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3966 2.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0200 3.4486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8259 3.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4422 3.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2753 4.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2253 3.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3268 0.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3221 -0.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
5 8 2 0
3 9 2 0
3 10 2 0
11 2 2 0
12 11 1 0
13 12 2 0
1 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
11 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
27 23 1 0
27 28 1 0
28 29 1 0
28 30 1 0
21 31 2 0
31 32 1 0
32 18 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.62Molecular Weight (Monoisotopic): 476.1552AlogP: 4.42#Rotatable Bonds: 8Polar Surface Area: 103.18Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.57CX Basic pKa: 6.79CX LogP: 3.29CX LogD: 3.77Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.24
References 1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M.. (2022) Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds., 65 [PMID:35550979 ] [10.1016/j.bmc.2022.116790 ]