The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-nitrophenyl 4-(4-butylbenzene-1-sulfonyl)piperazine-1-carboxylate ID: ALA5200684
PubChem CID: 163409122
Max Phase: Preclinical
Molecular Formula: C21H25N3O6S
Molecular Weight: 447.51
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1ccc(S(=O)(=O)N2CCN(C(=O)Oc3ccc([N+](=O)[O-])cc3)CC2)cc1
Standard InChI: InChI=1S/C21H25N3O6S/c1-2-3-4-17-5-11-20(12-6-17)31(28,29)23-15-13-22(14-16-23)21(25)30-19-9-7-18(8-10-19)24(26)27/h5-12H,2-4,13-16H2,1H3
Standard InChI Key: WSNBDRIOXKWWCY-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
0.7549 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0404 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6743 2.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3870 2.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3872 1.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6696 1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0419 1.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1017 1.0333 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3156 1.8317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8984 1.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1017 0.2083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3870 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3870 -1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1017 -1.4422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8164 -1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8164 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1017 -2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3872 -2.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6727 -2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6724 -1.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0402 -1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7549 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4694 -1.0317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4694 -0.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1839 -1.4442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7565 -2.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0447 -2.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8162 -2.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4694 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1839 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8984 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 5 1 0
8 9 2 0
8 10 2 0
11 8 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
16 11 1 0
14 17 1 0
17 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
22 23 1 0
23 24 2 0
23 25 1 0
26 22 1 0
27 26 2 0
19 27 1 0
17 28 2 0
1 29 1 0
29 30 1 0
30 31 1 0
M CHG 2 23 1 25 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.51Molecular Weight (Monoisotopic): 447.1464AlogP: 3.44#Rotatable Bonds: 7Polar Surface Area: 110.06Molecular Species: ┄HBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.17CX LogD: 4.17Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.51
References 1. Fulp A, Bingham S, Fisler B, Kho F, Kim J, Kim SJ, Martin T, Mims B, Reji Thomas K, Roe G, Spiotta J, Young J, Lazenka M.. (2022) Design and synthesis of endocannabinoid enzyme inhibitors for ocular indications., 68 [PMID:35500728 ] [10.1016/j.bmcl.2022.128763 ]