5-methoxy-2-(2-methylphenyl)-2,3-dihydroquinazolin-4(1H)-one

ID: ALA5200761

PubChem CID: 164880768

Max Phase: Preclinical

Molecular Formula: C16H16N2O2

Molecular Weight: 268.32

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc2c1C(=O)NC(c1ccccc1C)N2

Standard InChI:  InChI=1S/C16H16N2O2/c1-10-6-3-4-7-11(10)15-17-12-8-5-9-13(20-2)14(12)16(19)18-15/h3-9,15,17H,1-2H3,(H,18,19)

Standard InChI Key:  YHCIOAQQYLFMFI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   -2.5001   -0.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0727   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3577   -0.8257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    0.4127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3577    0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0727    0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7851    0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5001    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3577    1.6513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0724   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0724   -1.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7894   -2.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001   -1.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7876   -0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7851    1.6506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5001    2.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7876    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  7  1  0
  3  8  2  0
  8  9  1  0
  9 10  2  0
 10  1  1  0
  7 11  2  0
  5 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
  9 18  1  0
 18 19  1  0
 17 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5200761

    ---

Associated Targets(Human)

PBRM1 Tchem Protein polybromo-1 (712 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 268.32Molecular Weight (Monoisotopic): 268.1212AlogP: 2.86#Rotatable Bonds: 2
Polar Surface Area: 50.36Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.00CX Basic pKa: CX LogP: 3.40CX LogD: 3.40
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.88Np Likeness Score: -0.34

References

1. Shishodia S, Nuñez R, Strohmier BP, Bursch KL, Goetz CJ, Olp MD, Jensen DR, Fenske TG, Ordonez-Rubiano SC, Blau ME, Roach MK, Peterson FC, Volkman BF, Dykhuizen EC, Smith BC..  (2022)  Selective and Cell-Active PBRM1 Bromodomain Inhibitors Discovered through NMR Fragment Screening.,  65  (20.0): [PMID:36227159] [10.1021/acs.jmedchem.2c00864]

Source