The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(E)-3-[3-cyano-4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]-6-quinolyl]allyl]-2-methoxy-acetamide ID: ALA5200783
PubChem CID: 168291364
Max Phase: Preclinical
Molecular Formula: C28H24N8O3
Molecular Weight: 520.55
Associated Items:
Names and Identifiers Canonical SMILES: COCC(=O)NC/C=C/c1ccc2ncc(C#N)c(Nc3ccc(Oc4cc5nncn5cn4)c(C)c3)c2c1
Standard InChI: InChI=1S/C28H24N8O3/c1-18-10-21(6-8-24(18)39-27-12-25-35-33-17-36(25)16-32-27)34-28-20(13-29)14-31-23-7-5-19(11-22(23)28)4-3-9-30-26(37)15-38-2/h3-8,10-12,14,16-17H,9,15H2,1-2H3,(H,30,37)(H,31,34)/b4-3+
Standard InChI Key: WJQWKJBNZMOEBF-ONEGZZNKSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-1.7328 -1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0182 -0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3063 -1.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3063 -2.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0164 -2.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7328 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4063 -0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1212 -1.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1230 -2.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4114 -2.4745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8359 -0.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5505 -0.4116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4063 0.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1209 0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1211 1.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8341 1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5489 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5505 0.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8387 -0.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8341 2.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2635 1.6492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9782 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6928 1.6492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4074 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4074 0.4114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6928 -0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9782 0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8643 -0.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0206 -0.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6849 -0.8944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4474 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1620 -1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8767 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5913 -1.2355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.3060 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0206 -1.2355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3060 0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5913 0.4147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8767 0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
4 10 1 0
8 11 1 0
11 12 3 0
7 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
16 20 1 0
17 21 1 0
21 22 1 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 1 0
27 26 1 0
22 27 2 0
26 28 2 0
25 29 1 0
29 30 2 0
30 28 1 0
1 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.55Molecular Weight (Monoisotopic): 520.1971AlogP: 4.16#Rotatable Bonds: 9Polar Surface Area: 139.35Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.72CX LogP: 2.04CX LogD: 2.04Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.40
References 1. Li D, Tu Y, Jin K, Duan L, Hong Y, Xu J, Chen N, Zhang Z, Zuo H, Gong W, Zhang J, Wang Q, Qian H, Wang X, Ke Y, Xia G.. (2022) Discovery of SPH5030, a Selective, Potent, and Irreversible Tyrosine Kinase Inhibitor for HER2-Amplified and HER2-Mutant Cancer Treatment., 65 (7.0): [PMID:35319895 ] [10.1021/acs.jmedchem.1c00710 ]