3-[15-(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol

ID: ALA5200801

PubChem CID: 136049180

Max Phase: Preclinical

Molecular Formula: C32H22N4O2

Molecular Weight: 494.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4cccc(O)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1

Standard InChI:  InChI=1S/C32H22N4O2/c37-25-5-1-3-19(15-25)31-27-11-7-21(33-27)17-23-9-13-29(35-23)32(20-4-2-6-26(38)16-20)30-14-10-24(36-30)18-22-8-12-28(31)34-22/h1-18,33,36-38H/b21-17-,22-18-,23-17-,24-18-,31-27-,31-28-,32-29-,32-30-

Standard InChI Key:  DUUMHZSDMWUASS-DTEHSSGNSA-N

Molfile:  

 
     RDKit          2D

 38 44  0  0  0  0  0  0  0  0999 V2000
    0.6282   -1.0609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2931   -1.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9074   -2.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6333   -1.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4658   -1.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0243   -0.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8339   -0.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0573   -1.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8670   -1.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4534   -1.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2300   -0.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4203   -0.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8164    0.2234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8567    0.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4151    0.9214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9963    1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1866    1.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5444    2.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2653    1.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8795    2.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6054    1.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4379    1.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9963    0.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8060    0.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3924    0.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2021    0.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4255    1.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8392    1.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0294    1.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8164   -0.1954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8288   -0.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3872   -0.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9684   -1.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1587   -1.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5165   -2.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0749   -0.6142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6003    1.0889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0749    0.6422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  5  1  0
  6  5  2  0
  6  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
  7 12  2  0
 11 13  1  0
 14  6  1  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 19 20  2  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  1  0
 25 24  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 24 29  1  0
 26 30  1  0
 31 23  2  0
 32 31  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
  2 35  2  0
 34 36  2  0
 31 36  1  0
 22 37  1  0
 37 19  1  0
 17 38  1  0
 14 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5200801

    ---

Associated Targets(Human)

WiDr (1835 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.55Molecular Weight (Monoisotopic): 494.1743AlogP: 7.40#Rotatable Bonds: 2
Polar Surface Area: 97.82Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.41CX Basic pKa: 5.00CX LogP: 7.32CX LogD: 7.31
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: 0.29

References

1. Janas K, Boniewska-Bernacka E, Dyrda G, Słota R..  (2021)  Porphyrin and phthalocyanine photosensitizers designed for targeted photodynamic therapy of colorectal cancer.,  30  [PMID:33341498] [10.1016/j.bmc.2020.115926]

Source