The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[15-(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol ID: ALA5200801
PubChem CID: 136049180
Max Phase: Preclinical
Molecular Formula: C32H22N4O2
Molecular Weight: 494.55
Associated Items:
Names and Identifiers Canonical SMILES: Oc1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4cccc(O)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1
Standard InChI: InChI=1S/C32H22N4O2/c37-25-5-1-3-19(15-25)31-27-11-7-21(33-27)17-23-9-13-29(35-23)32(20-4-2-6-26(38)16-20)30-14-10-24(36-30)18-22-8-12-28(31)34-22/h1-18,33,36-38H/b21-17-,22-18-,23-17-,24-18-,31-27-,31-28-,32-29-,32-30-
Standard InChI Key: DUUMHZSDMWUASS-DTEHSSGNSA-N
Molfile:
RDKit 2D
38 44 0 0 0 0 0 0 0 0999 V2000
0.6282 -1.0609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2931 -1.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9074 -2.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6333 -1.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4658 -1.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0243 -0.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8339 -0.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0573 -1.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8670 -1.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4534 -1.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2300 -0.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4203 -0.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8164 0.2234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8567 0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4151 0.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9963 1.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1866 1.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5444 2.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2653 1.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8795 2.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6054 1.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4379 1.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9963 0.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8060 0.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3924 0.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2021 0.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4255 1.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8392 1.7869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0294 1.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8164 -0.1954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8288 -0.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3872 -0.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9684 -1.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1587 -1.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5165 -2.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0749 -0.6142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6003 1.0889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0749 0.6422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
1 5 1 0
6 5 2 0
6 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
7 12 2 0
11 13 1 0
14 6 1 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
19 20 2 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 1 0
25 24 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
24 29 1 0
26 30 1 0
31 23 2 0
32 31 1 0
32 33 2 0
33 34 1 0
34 35 1 0
2 35 2 0
34 36 2 0
31 36 1 0
22 37 1 0
37 19 1 0
17 38 1 0
14 38 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.55Molecular Weight (Monoisotopic): 494.1743AlogP: 7.40#Rotatable Bonds: 2Polar Surface Area: 97.82Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.41CX Basic pKa: 5.00CX LogP: 7.32CX LogD: 7.31Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: 0.29
References 1. Janas K, Boniewska-Bernacka E, Dyrda G, Słota R.. (2021) Porphyrin and phthalocyanine photosensitizers designed for targeted photodynamic therapy of colorectal cancer., 30 [PMID:33341498 ] [10.1016/j.bmc.2020.115926 ]