The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4,4-dimethyl-7-(4-methylpiperazin-1-yl)-8-nitrochromeno[4,3-c]pyrazol-1(4H)-yl)benzoic acid ID: ALA5200810
PubChem CID: 168290379
Max Phase: Preclinical
Molecular Formula: C24H25N5O5
Molecular Weight: 463.49
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2cc3c(cc2[N+](=O)[O-])-c2c(cnn2-c2ccc(C(=O)O)cc2)C(C)(C)O3)CC1
Standard InChI: InChI=1S/C24H25N5O5/c1-24(2)18-14-25-28(16-6-4-15(5-7-16)23(30)31)22(18)17-12-20(29(32)33)19(13-21(17)34-24)27-10-8-26(3)9-11-27/h4-7,12-14H,8-11H2,1-3H3,(H,30,31)
Standard InChI Key: RTTHBCYSJNGALT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-0.4115 -0.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3030 -0.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0148 -0.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0148 -1.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3048 -2.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4115 -1.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7295 -0.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4442 -0.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4442 -1.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7295 -2.1732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0573 -0.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9011 0.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7218 0.3704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3176 0.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5204 0.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0607 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1529 2.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9456 2.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5321 1.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1262 -0.5231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1262 0.3019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8408 -0.9357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8575 -2.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2701 -1.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4306 2.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2276 2.4039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2170 3.4146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1262 -2.1768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1262 -3.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8408 -1.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8408 -3.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5554 -2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5554 -3.0020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2701 -3.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
8 11 1 0
7 12 1 0
12 13 1 0
13 11 2 0
14 12 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
14 19 1 0
19 18 2 0
20 1 1 0
20 21 1 0
20 22 2 0
9 23 1 0
9 24 1 0
17 25 1 0
25 26 2 0
25 27 1 0
6 28 1 0
28 29 1 0
28 30 1 0
29 31 1 0
30 32 1 0
31 33 1 0
33 32 1 0
33 34 1 0
M CHG 2 20 1 21 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.49Molecular Weight (Monoisotopic): 463.1856AlogP: 3.53#Rotatable Bonds: 4Polar Surface Area: 113.97Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.54CX Basic pKa: 7.07CX LogP: 1.11CX LogD: 0.71Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -0.89
References 1. Hwang J, Qiu X, Borgelt L, Haacke N, Kanis L, Petroulia S, Gasper R, Schiller D, Lampe P, Sievers S, Imig J, Wu P.. (2022) Synthesis and evaluation of RNase L-binding 2-aminothiophenes as anticancer agents., 58 [PMID:35152173 ] [10.1016/j.bmc.2022.116653 ]