(S)-N-(3-(3-(2,3-dioxo-3,4-dihydropyrazin-1(2H)-yl)propanamido)-1-(methylamino)-1-oxopropan-2-yl)-5-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxamide

ID: ALA5200815

PubChem CID: 168290384

Max Phase: Preclinical

Molecular Formula: C22H25N5O6

Molecular Weight: 455.47

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)[C@H](CNC(=O)CCn1cc[nH]c(=O)c1=O)NC(=O)c1ccc2c(c1)CCCC2=O

Standard InChI:  InChI=1S/C22H25N5O6/c1-23-20(31)16(12-25-18(29)7-9-27-10-8-24-21(32)22(27)33)26-19(30)14-5-6-15-13(11-14)3-2-4-17(15)28/h5-6,8,10-11,16H,2-4,7,9,12H2,1H3,(H,23,31)(H,24,32)(H,25,29)(H,26,30)/t16-/m0/s1

Standard InChI Key:  YSKKQSYDDVIHKE-INIZCTEOSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    3.5674    1.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2817    1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9962    1.0297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9962    0.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2817   -0.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5674    0.2048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8532   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1389    0.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4248   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7106    0.2048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4248   -1.0322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0035   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7178    0.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4319   -0.2075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7178    1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0036    1.4418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0035    2.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4319    1.4418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1461    0.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8604   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1461    1.0295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8605   -1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5730   -1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2875   -1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2890   -0.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5776    0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9973   -1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7088   -1.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7104   -0.2123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0005    0.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9973   -2.2665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2817   -1.0323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7104   -0.2075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 13 12  1  6
 13 14  1  0
 15 13  1  0
 15 16  1  0
 16 17  1  0
 15 18  2  0
 14 19  1  0
 19 20  1  0
 19 21  2  0
 22 20  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 20 26  1  0
 24 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 25 30  1  0
 27 31  2  0
  5 32  2  0
  4 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5200815

    ---

Associated Targets(Human)

PARP10 Tchem Poly [ADP-ribose] polymerase 10 (418 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.47Molecular Weight (Monoisotopic): 455.1805AlogP: -0.89#Rotatable Bonds: 8
Polar Surface Area: 159.23Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.66CX Basic pKa: CX LogP: -1.60CX LogD: -1.76
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.82

References

1. Nizi MG, Maksimainen MM, Lehtiö L, Tabarrini O..  (2022)  Medicinal Chemistry Perspective on Targeting Mono-ADP-Ribosylating PARPs with Small Molecules.,  65  (11.0): [PMID:35608571] [10.1021/acs.jmedchem.2c00281]

Source