The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-(3-(2,3-dioxo-3,4-dihydropyrazin-1(2H)-yl)propanamido)-1-(methylamino)-1-oxopropan-2-yl)-5-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxamide ID: ALA5200815
PubChem CID: 168290384
Max Phase: Preclinical
Molecular Formula: C22H25N5O6
Molecular Weight: 455.47
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@H](CNC(=O)CCn1cc[nH]c(=O)c1=O)NC(=O)c1ccc2c(c1)CCCC2=O
Standard InChI: InChI=1S/C22H25N5O6/c1-23-20(31)16(12-25-18(29)7-9-27-10-8-24-21(32)22(27)33)26-19(30)14-5-6-15-13(11-14)3-2-4-17(15)28/h5-6,8,10-11,16H,2-4,7,9,12H2,1H3,(H,23,31)(H,24,32)(H,25,29)(H,26,30)/t16-/m0/s1
Standard InChI Key: YSKKQSYDDVIHKE-INIZCTEOSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
3.5674 1.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2817 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9962 1.0297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9962 0.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2817 -0.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5674 0.2048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8532 -0.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1389 0.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4248 -0.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7106 0.2048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4248 -1.0322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0035 -0.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7178 0.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4319 -0.2075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7178 1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0036 1.4418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0035 2.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4319 1.4418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1461 0.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8604 -0.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1461 1.0295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8605 -1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5730 -1.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2875 -1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2890 -0.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5776 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9973 -1.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7088 -1.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7104 -0.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0005 0.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9973 -2.2665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2817 -1.0323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7104 -0.2075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
13 12 1 6
13 14 1 0
15 13 1 0
15 16 1 0
16 17 1 0
15 18 2 0
14 19 1 0
19 20 1 0
19 21 2 0
22 20 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
20 26 1 0
24 27 1 0
28 27 1 0
29 28 1 0
30 29 1 0
25 30 1 0
27 31 2 0
5 32 2 0
4 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.47Molecular Weight (Monoisotopic): 455.1805AlogP: -0.89#Rotatable Bonds: 8Polar Surface Area: 159.23Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.66CX Basic pKa: ┄CX LogP: -1.60CX LogD: -1.76Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.82
References 1. Nizi MG, Maksimainen MM, Lehtiö L, Tabarrini O.. (2022) Medicinal Chemistry Perspective on Targeting Mono-ADP-Ribosylating PARPs with Small Molecules., 65 (11.0): [PMID:35608571 ] [10.1021/acs.jmedchem.2c00281 ]