2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-pyridyl)-N-(3,4,5-trimethoxyphenyl)acetamide

ID: ALA5200852

PubChem CID: 168291954

Max Phase: Preclinical

Molecular Formula: C23H21N3O4S2

Molecular Weight: 467.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N(C(=O)CSc2nc3ccccc3s2)c2ccncc2)cc(OC)c1OC

Standard InChI:  InChI=1S/C23H21N3O4S2/c1-28-18-12-16(13-19(29-2)22(18)30-3)26(15-8-10-24-11-9-15)21(27)14-31-23-25-17-6-4-5-7-20(17)32-23/h4-13H,14H2,1-3H3

Standard InChI Key:  FGCCQYQEHCBGFM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -0.7926    0.1273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7753    1.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0846   -0.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6361    0.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3441   -0.3182    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.0649    0.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1638    0.9021    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9734    1.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3747    0.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8133   -0.2640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1997    0.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6232    1.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2218    1.7563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3969    1.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0974   -1.1210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7656   -0.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7784   -1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4992   -1.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2072   -1.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1944   -0.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4736    0.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9024    0.0311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6232   -0.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9280   -1.6186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9407   -2.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5119   -2.4656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8039   -2.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4835    1.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4699    2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7487    2.8891    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0432    2.4689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0512    1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  6  1  0
  7  8  1  0
  8  9  2  0
 10  9  1  0
  6 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  8 14  1  0
  3 15  2  0
  1 16  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 16 21  1  0
 20 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
 18 26  1  0
 26 27  1  0
 28  2  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
  2 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5200852

    ---

Associated Targets(Human)

CWR22R (2180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.57Molecular Weight (Monoisotopic): 467.0973AlogP: 5.17#Rotatable Bonds: 8
Polar Surface Area: 73.78Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.23CX Basic pKa: 4.29CX LogP: 3.86CX LogD: 3.86
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: -1.52

References

1. Arya GC, Kaur K, Jaitak V..  (2021)  Isoxazole derivatives as anticancer agent: A review on synthetic strategies, mechanism of action and SAR studies.,  221  [PMID:34000484] [10.1016/j.ejmech.2021.113511]

Source