The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-pyridyl)-N-(3,4,5-trimethoxyphenyl)acetamide ID: ALA5200852
PubChem CID: 168291954
Max Phase: Preclinical
Molecular Formula: C23H21N3O4S2
Molecular Weight: 467.57
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N(C(=O)CSc2nc3ccccc3s2)c2ccncc2)cc(OC)c1OC
Standard InChI: InChI=1S/C23H21N3O4S2/c1-28-18-12-16(13-19(29-2)22(18)30-3)26(15-8-10-24-11-9-15)21(27)14-31-23-25-17-6-4-5-7-20(17)32-23/h4-13H,14H2,1-3H3
Standard InChI Key: FGCCQYQEHCBGFM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-0.7926 0.1273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7753 1.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0846 -0.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6361 0.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3441 -0.3182 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.0649 0.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1638 0.9021 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9734 1.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3747 0.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8133 -0.2640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1997 0.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6232 1.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2218 1.7563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3969 1.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0974 -1.1210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7656 -0.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7784 -1.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4992 -1.6407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2072 -1.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1944 -0.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4736 0.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9024 0.0311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6232 -0.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9280 -1.6186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9407 -2.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5119 -2.4656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8039 -2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4835 1.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4699 2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7487 2.8891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0432 2.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0512 1.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 6 1 0
7 8 1 0
8 9 2 0
10 9 1 0
6 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
8 14 1 0
3 15 2 0
1 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
21 20 2 0
16 21 1 0
20 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
18 26 1 0
26 27 1 0
28 2 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
2 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.57Molecular Weight (Monoisotopic): 467.0973AlogP: 5.17#Rotatable Bonds: 8Polar Surface Area: 73.78Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.23CX Basic pKa: 4.29CX LogP: 3.86CX LogD: 3.86Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: -1.52
References 1. Arya GC, Kaur K, Jaitak V.. (2021) Isoxazole derivatives as anticancer agent: A review on synthetic strategies, mechanism of action and SAR studies., 221 [PMID:34000484 ] [10.1016/j.ejmech.2021.113511 ]