3-[3-[(1-benzyl-4-piperidyl)methyl]-5-methyl-2-oxo-hexahydropyrimidin-1-yl]benzamidine;2,2,2-trifluoroacetic acid

ID: ALA5200864

Cas Number: 1832686-44-8

PubChem CID: 102004307

Product Number: S412134, Order Now?

Max Phase: Preclinical

Molecular Formula: C27H34F3N5O3

Molecular Weight: 419.57

Associated Items:

This product is currently unavailable

Names and Identifiers

Canonical SMILES:  CC1CN(CC2CCN(Cc3ccccc3)CC2)C(=O)N(c2cccc(C(=N)N)c2)C1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C25H33N5O.C2HF3O2/c1-19-15-29(25(31)30(16-19)23-9-5-8-22(14-23)24(26)27)18-21-10-12-28(13-11-21)17-20-6-3-2-4-7-20;3-2(4,5)1(6)7/h2-9,14,19,21H,10-13,15-18H2,1H3,(H3,26,27);(H,6,7)

Standard InChI Key:  QJFJKJLPPLYFJA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   -3.8023   -1.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0878   -1.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8023   -2.4749    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5172   -1.2366    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5172   -2.0621    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0878   -0.4113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3729   -1.6495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7881    0.8248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0736    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3592    0.8248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3592   -0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0736   -0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7881   -0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0736   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3557    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0706    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5004    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5004   -0.0007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855   -0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0706   -0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2152   -0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9302   -0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9304    0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6436    1.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3586    0.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3603    0.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6481   -0.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5030    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2181    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9305    1.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9305    2.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2199    2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5030    2.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6454    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6454   -0.0011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3603    1.2371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0736    2.0628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  1  0
  1  5  1  0
  2  6  2  0
  2  7  1  0
  8  9  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
  8 13  1  0
 13 12  1  0
 12 14  1  0
 10 15  1  0
 15 16  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 16 21  1  0
 19 22  1  0
 22 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
  8 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 31 35  1  0
 35 36  2  0
 35 37  1  0
  9 38  2  0
M  END

Associated Targets(non-human)

Hepatocyte (1455 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.2685AlogP: 3.76#Rotatable Bonds: 6
Polar Surface Area: 76.66Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 11.17CX LogP: 2.69CX LogD: -1.22
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.19

References

1. Liang F, Xu X, Tu Y..  (2022)  Resveratrol inhibited hepatocyte apoptosis and alleviated liver fibrosis through miR-190a-5p /HGF axis.,  57  [PMID:35093804] [10.1016/j.bmc.2021.116593]

Source