The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[3-[(1-benzyl-4-piperidyl)methyl]-5-methyl-2-oxo-hexahydropyrimidin-1-yl]benzamidine;2,2,2-trifluoroacetic acid ID: ALA5200864
Cas Number: 1832686-44-8
PubChem CID: 102004307
Product Number: S412134, Order Now?
Max Phase: Preclinical
Molecular Formula: C27H34F3N5O3
Molecular Weight: 419.57
Associated Items:
Names and Identifiers Canonical SMILES: CC1CN(CC2CCN(Cc3ccccc3)CC2)C(=O)N(c2cccc(C(=N)N)c2)C1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C25H33N5O.C2HF3O2/c1-19-15-29(25(31)30(16-19)23-9-5-8-22(14-23)24(26)27)18-21-10-12-28(13-11-21)17-20-6-3-2-4-7-20;3-2(4,5)1(6)7/h2-9,14,19,21H,10-13,15-18H2,1H3,(H3,26,27);(H,6,7)
Standard InChI Key: QJFJKJLPPLYFJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
-3.8023 -1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0878 -1.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8023 -2.4749 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5172 -1.2366 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5172 -2.0621 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.0878 -0.4113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3729 -1.6495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7881 0.8248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0736 1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3592 0.8248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3592 -0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0736 -0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7881 -0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0736 -1.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3557 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0706 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7855 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5004 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5004 -0.0007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7855 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0706 -0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2152 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9302 -0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9304 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6436 1.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3586 0.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3603 0.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6481 -0.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5030 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2181 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9305 1.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9305 2.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2199 2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5030 2.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6454 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6454 -0.0011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.3603 1.2371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0736 2.0628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
1 5 1 0
2 6 2 0
2 7 1 0
8 9 1 0
10 9 1 0
11 10 1 0
12 11 1 0
8 13 1 0
13 12 1 0
12 14 1 0
10 15 1 0
15 16 1 0
17 16 1 0
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
16 21 1 0
19 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
8 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
31 35 1 0
35 36 2 0
35 37 1 0
9 38 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.2685AlogP: 3.76#Rotatable Bonds: 6Polar Surface Area: 76.66Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 11.17CX LogP: 2.69CX LogD: -1.22Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.19
References 1. Liang F, Xu X, Tu Y.. (2022) Resveratrol inhibited hepatocyte apoptosis and alleviated liver fibrosis through miR-190a-5p /HGF axis., 57 [PMID:35093804 ] [10.1016/j.bmc.2021.116593 ]