The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-methoxybenzamido)-5-(4-(2-((2-methoxyethyl)amino)-2-oxoethyl)piperazin-1-yl)benzoic acid ID: ALA5201176
PubChem CID: 50782533
Max Phase: Preclinical
Molecular Formula: C24H30N4O6
Molecular Weight: 470.53
Associated Items:
Names and Identifiers Canonical SMILES: COCCNC(=O)CN1CCN(c2ccc(NC(=O)c3ccc(OC)cc3)c(C(=O)O)c2)CC1
Standard InChI: InChI=1S/C24H30N4O6/c1-33-14-9-25-22(29)16-27-10-12-28(13-11-27)18-5-8-21(20(15-18)24(31)32)26-23(30)17-3-6-19(34-2)7-4-17/h3-8,15H,9-14,16H2,1-2H3,(H,25,29)(H,26,30)(H,31,32)
Standard InChI Key: BNWOGCXYISBJFX-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
6.2844 -0.7435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8677 -0.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4875 -0.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9443 -1.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1355 -0.9852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8731 -0.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4205 0.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2261 0.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0649 -0.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5177 -0.6518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7094 -0.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1661 -1.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3798 -1.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1766 -2.1126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7964 -2.4825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3575 -0.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0951 -0.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6424 0.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4481 0.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7131 0.0089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2603 -0.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0689 -0.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3302 0.3391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7830 0.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9744 0.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1553 0.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5677 1.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3926 1.0535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8052 1.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6301 1.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0427 2.4825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.8677 2.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1553 1.7680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8036 0.7482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 1 1 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
3 8 2 0
9 6 1 0
10 9 1 0
11 10 1 0
12 11 1 0
12 13 1 0
13 14 1 0
13 15 2 0
16 12 2 0
17 16 1 0
18 17 2 0
19 18 1 0
11 19 2 0
17 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 1 0
20 25 1 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 33 2 0
9 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.2165AlogP: 1.53#Rotatable Bonds: 10Polar Surface Area: 120.44Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.04CX Basic pKa: 6.27CX LogP: -0.02CX LogD: -0.98Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.64
References 1. Dobrovolskaite A, Moots H, Tantak MP, Shah K, Thomas J, Dinara S, Massaro C, Hershberger PM, Maloney PR, Peddibhotla S, Sugarman E, Litherland S, Arnoletti JP, Jha RK, Levens D, Phanstiel O.. (2022) Discovery of Anthranilic Acid Derivatives as Difluoromethylornithine Adjunct Agents That Inhibit Far Upstream Element Binding Protein 1 (FUBP1) Function., 65 (22.0): [PMID:36382923 ] [10.1021/acs.jmedchem.2c01350 ]