2-(4-methoxybenzamido)-5-(4-(2-((2-methoxyethyl)amino)-2-oxoethyl)piperazin-1-yl)benzoic acid

ID: ALA5201176

PubChem CID: 50782533

Max Phase: Preclinical

Molecular Formula: C24H30N4O6

Molecular Weight: 470.53

Names and Identifiers

Canonical SMILES:  COCCNC(=O)CN1CCN(c2ccc(NC(=O)c3ccc(OC)cc3)c(C(=O)O)c2)CC1

Standard InChI:  InChI=1S/C24H30N4O6/c1-33-14-9-25-22(29)16-27-10-12-28(13-11-27)18-5-8-21(20(15-18)24(31)32)26-23(30)17-3-6-19(34-2)7-4-17/h3-8,15H,9-14,16H2,1-2H3,(H,25,29)(H,26,30)(H,31,32)

Standard InChI Key:  BNWOGCXYISBJFX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    6.2844   -0.7435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8677   -0.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4875   -0.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9443   -1.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1355   -0.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8731   -0.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4205    0.4180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2261    0.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0649   -0.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5177   -0.6518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7094   -0.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1661   -1.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3798   -1.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1766   -2.1126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7964   -2.4825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3575   -0.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0951   -0.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6424    0.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4481    0.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7131    0.0089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2603   -0.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0689   -0.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3302    0.3391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7830    0.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9744    0.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1553    0.3391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5677    1.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3926    1.0535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8052    1.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6301    1.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0427    2.4825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8677    2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1553    1.7680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8036    0.7482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  3  8  2  0
  9  6  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 16 12  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 11 19  2  0
 17 20  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 23 24  1  0
 25 24  1  0
 20 25  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 27 33  2  0
  9 34  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA5201176

   2-(4-Methoxybenzamido)-5-(4-{[(2-methoxyethyl)carbamoyl]methyl}piperazin-1-YL)benzoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type:

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 470.53

Molecular Weight (Monoisotopic): 470.2165

AlogP: 1.53

#Rotatable Bonds: 10

Polar Surface Area: 120.44

Molecular Species: ACID

HBA: 7

HBD: 3

#RO5 Violations: ┄

HBA (Lipinski): 10

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 4.04

CX Basic pKa: 6.27

CX LogP: -0.02

CX LogD: -0.98

Aromatic Rings: 2

Heavy Atoms: 34

QED Weighted: 0.45

Np Likeness Score: -1.64

References

1. Dobrovolskaite A, Moots H, Tantak MP, Shah K, Thomas J, Dinara S, Massaro C, Hershberger PM, Maloney PR, Peddibhotla S, Sugarman E, Litherland S, Arnoletti JP, Jha RK, Levens D, Phanstiel O..  (2022)  Discovery of Anthranilic Acid Derivatives as Difluoromethylornithine Adjunct Agents That Inhibit Far Upstream Element Binding Protein 1 (FUBP1) Function.,  65  (22.0): [PMID:36382923] [10.1021/acs.jmedchem.2c01350]

Source

Source(1):

• Scientific Literature