(R)-2-(1H-indol-4-yl)-6-(1-methyl-1H-pyrazol-5-yl)-4-(2-methylpiperazin-1-yl)quinazoline

ID: ALA5201457

PubChem CID: 168290465

Max Phase: Preclinical

Molecular Formula: C25H25N7

Molecular Weight: 423.52

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1CNCCN1c1nc(-c2cccc3[nH]ccc23)nc2ccc(-c3ccnn3C)cc12

Standard InChI:  InChI=1S/C25H25N7/c1-16-15-26-12-13-32(16)25-20-14-17(23-9-11-28-31(23)2)6-7-22(20)29-24(30-25)19-4-3-5-21-18(19)8-10-27-21/h3-11,14,16,26-27H,12-13,15H2,1-2H3/t16-/m1/s1

Standard InChI Key:  LQVKHGLBMNYUBN-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
    2.4705    1.0272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1846    1.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1846    2.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4724    2.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7622    2.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7622    1.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0528    1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3381    1.4425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3697    1.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3697    0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3402   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0528    0.2053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3402   -1.0245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0507   -1.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0507   -2.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3400   -2.6715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3705   -2.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3705   -1.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7615   -1.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0818   -0.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7929    0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7929    1.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0818    1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5018   -0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2498    0.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7982   -0.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3889   -1.1942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5838   -1.0227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9736   -1.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7982    0.8887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4634    0.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6425    0.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 10 11  1  0
  7 12  1  0
 12 11  2  0
 13 11  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 13 18  1  0
 14 19  1  6
 10 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
  9 23  1  0
 24 21  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 28 24  1  0
 29 28  1  0
  2 30  1  0
 30 31  1  0
 31 32  2  0
  1 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5201457

    ---

Associated Targets(Human)

ATR Tchem Serine-protein kinase ATR (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.2171AlogP: 3.98#Rotatable Bonds: 3
Polar Surface Area: 74.66Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.89CX LogP: 4.44CX LogD: 2.94
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -1.04

References

1. Bin H, Chen P, Wu M, Wang F, Lin G, Pan S, Liu J, Mu B, Nan J, Huang Q, Li L, Yang S..  (2022)  Discovery of a potent and highly selective inhibitor of ataxia telangiectasia mutated and Rad3-Related (ATR) kinase: Structural activity relationship and antitumor activity both in vitro and in vivo.,  232  [PMID:35183872] [10.1016/j.ejmech.2022.114187]

Source