5-fluoro-2-((1-(4-fluorophenyl)ethyl)amino)-6-((5-methyl-1H-pyrazol-3-yl)amino)nicotinonitrile

ID: ALA5202069

PubChem CID: 56965903

Max Phase: Preclinical

Molecular Formula: C18H16F2N6

Molecular Weight: 354.36

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Nc2nc(NC(C)c3ccc(F)cc3)c(C#N)cc2F)n[nH]1

Standard InChI:  InChI=1S/C18H16F2N6/c1-10-7-16(26-25-10)23-18-15(20)8-13(9-21)17(24-18)22-11(2)12-3-5-14(19)6-4-12/h3-8,11H,1-2H3,(H3,22,23,24,25,26)

Standard InChI Key:  SUNXHXDJOIXABJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    1.0721    0.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7867    1.1558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986    0.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986   -0.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7885   -0.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0721   -0.0850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7885   -1.3182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2132   -0.4938    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.7867    1.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7867    2.8060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3575    1.1560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570    0.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0717    1.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -0.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7865    0.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    1.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    1.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7883    2.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0717    1.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2132    2.3937    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0739   -1.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0739   -2.5559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2697   -2.8060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2010   -2.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2910   -1.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0262   -2.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  4  8  1  0
  2  9  1  0
  9 10  3  0
  1 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  1  0
 15 13  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 13 19  1  0
 17 20  1  0
  7 21  1  0
 22 21  2  0
 22 23  1  0
 23 24  1  0
 25 24  2  0
 21 25  1  0
 24 26  1  0
M  END

Associated Targets(Human)

NUAK1 Tchem NUAK family SNF1-like kinase 1 (1769 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.36Molecular Weight (Monoisotopic): 354.1405AlogP: 4.18#Rotatable Bonds: 5
Polar Surface Area: 89.42Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.08CX Basic pKa: 2.70CX LogP: 4.24CX LogD: 4.24
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.64Np Likeness Score: -1.70

References

1. Faisal M, Kim JH, Yoo KH, Roh EJ, Hong SS, Lee SH..  (2021)  Development and Therapeutic Potential of NUAKs Inhibitors.,  64  (1.0): [PMID:33356242] [10.1021/acs.jmedchem.0c00533]

Source