4,5,11-trimethyl-2-((1-(piperidin-4-yl)-1H-pyrazol-4-yl)amino)-5,11-dihydro-6H-benzo[e]pyrimido[5,4-b][1,4]diazepin-6-one

ID: ALA5202161

PubChem CID: 86267817

Max Phase: Preclinical

Molecular Formula: C22H26N8O

Molecular Weight: 418.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(Nc2cnn(C3CCNCC3)c2)nc2c1N(C)C(=O)c1ccccc1N2C

Standard InChI:  InChI=1S/C22H26N8O/c1-14-19-20(28(2)18-7-5-4-6-17(18)21(31)29(19)3)27-22(25-14)26-15-12-24-30(13-15)16-8-10-23-11-9-16/h4-7,12-13,16,23H,8-11H2,1-3H3,(H,25,26,27)

Standard InChI Key:  LJORJQJUACCUBV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -3.8155   -2.0064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8155   -2.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1021   -3.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3951   -2.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3951   -2.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1039   -1.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2297   -0.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6786   -0.1835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8554   -0.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3901   -0.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6272   -1.7001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0480   -2.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5696   -0.8472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2226   -0.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6871    0.5652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5043    0.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9139    1.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5964   -0.1051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0060    0.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5964    1.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1636    1.9278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8927    1.5995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8011    0.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6021    2.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6021    2.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3115    3.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0209    2.8282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0209    2.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3115    1.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8905    0.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0209   -0.5744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 11 10  1  0
  5 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
  9 16  1  0
 16 17  1  0
 14 18  1  0
 18 19  1  0
 20 19  1  0
 20 21  2  0
 21 22  1  0
 23 22  1  0
 19 23  2  0
 22 24  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 24 29  1  0
  8 30  1  0
  7 31  2  0
M  END

Associated Targets(Human)

NUAK1 Tchem NUAK family SNF1-like kinase 1 (1769 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.51Molecular Weight (Monoisotopic): 418.2230AlogP: 3.01#Rotatable Bonds: 3
Polar Surface Area: 91.21Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.12CX Basic pKa: 10.08CX LogP: 1.30CX LogD: -1.00
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.68Np Likeness Score: -1.09

References

1. Faisal M, Kim JH, Yoo KH, Roh EJ, Hong SS, Lee SH..  (2021)  Development and Therapeutic Potential of NUAKs Inhibitors.,  64  (1.0): [PMID:33356242] [10.1021/acs.jmedchem.0c00533]

Source